Sodium-D-glucuronate
Sodium glucuronate is an organic molecular entity.
A sugar acid formed by the oxidation of the C-6 carbon of GLUCOSE. In addition to being a key intermediate metabolite of the uronic acid pathway, glucuronic acid also plays a role in the detoxification of certain drugs and toxins by conjugating with them to form GLUCURONIDES.
| CAS Number | 14984-34-0 |
| Product Name | Sodium glucuronate |
| IUPAC Name | sodium;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoate |
| Molecular Formula | C6H9NaO7 |
| Molecular Weight | 216.12 |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h1-5,8-11H,(H,12,13);/q;+1/p-1/t2-,3+,4-,5-;/m0./s1 |
| SMILES | C(=O)C(C(C(C(C(=O)[O-])O)O)O)O.[Na+] |
CAS No: 207300-70-7,14984-34-0,7182-77-6 Synonyms: D-Glucuronic acid sodium saltD-Glucuronic acid sodium salt monohydrate MDL No: MFCD00135616 Chemical Formula:
C6H9NaO7?H2O
Molecular Weight: 234.14 |