4-Chlorophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
4-Chlorophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a molecule that belongs to the class of acid molecules and has been implicated in the metabolism of corynebacterium. The metabolic pathway for this molecule has been studied using databases and datasets, with population simulations and profile data being generated to help identify potential strategies for its positioning in the market. This molecule is also related to death, which may be related to its positioning.
| CAS Number | 50730-05-7 |
| Product Name | N-[(2S,3R,4R,5S,6R)-2-(4-chlorophenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| IUPAC Name | N-[2-(4-chlorophenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| Molecular Formula | C14H18ClNO6 |
| Molecular Weight | 331.75 g/mol |
| InChI | InChI=1S/C14H18ClNO6/c1-7(18)16-11-13(20)12(19)10(6-17)22-14(11)21-9-4-2-8(15)3-5-9/h2-5,10-14,17,19-20H,6H2,1H3,(H,16,18) |
| InChI Key | UTBWZDLYARDESN-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=C(C=C2)Cl)CO)O)O |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=C(C=C2)Cl)CO)O)O |
CAS No: 50730-05-7 MDL No: MFCD08704060 Chemical Formula: C14H18ClNO6 Molecular Weight: 331.75 |