1-Naphthyl b-D-glucuronide
1-Naphthyl ?-D-glucuronide (1NG) is a glucuronide conjugate that is used as an experimental model to study the transport of drugs across cell membranes. 1NG has been shown to inhibit the activity of p-glycoprotein, which may be due to its ability to bind to the ATP binding site on this transporter. 1NG inhibits the uptake of carbaryl and dinucleotide phosphate by primary cells, which could be due to its ability to inhibit enzyme activities. This compound also interacts with other drugs, such as atenolol and erythromycin, which can lead to drug interactions.
| CAS Number | 17238-47-0 |
| Product Name | 1-Naphthyl glucuronide |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-naphthalen-1-yloxyoxane-2-carboxylic acid |
| Molecular Formula | C16H16O7 |
| Molecular Weight | 320.29 g/mol |
| InChI | InChI=1S/C16H16O7/c17-11-12(18)14(15(20)21)23-16(13(11)19)22-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11-14,16-19H,(H,20,21)/t11-,12-,13+,14-,16+/m0/s1 |
| InChI Key | KEQWBZWOGRCILF-JHZZJYKESA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O |
| Synonyms | 1-naphthol-beta-D-glucuronide, 1-naphthyl glucuronide, naphthyl glucuronide, naphthyl glucuronide, (beta-D)-isomer, naphthyl glucuronide, monosodium salt |
| Canonical SMILES | C1=CC=C2C(=C1)C=CC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O |
| Isomeric SMILES | C1=CC=C2C(=C1)C=CC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |