Naphthol AS-D chloroacetate
2-(O-tolylcarbamoyl)naphthalen-3-yl 2-chloroacetate: Definition and Background
2-(O-tolylcarbamoyl)naphthalen-3-yl 2-chloroacetate is a compound belonging to the class of organic compounds known as naphthalenes. Naphthalenes, also called naphthalene or tar camphor, are a type of polycyclic aromatic hydrocarbon (PAH) consisting of two fused benzene rings. 2-(O-tolylcarbamoyl)naphthalen-3-yl 2-chloroacetate is a derivative of naphthalene that has two functional groups attached to it: a tolylcarbamoyl group (C7H7NHCO-) and a chloroacetyl group (ClCH2CO-). This compound has been the subject of research in various fields such as medicinal chemistry, materials science, and organic synthesis.
| CAS Number | 35245-26-2 |
| Product Name | 2-(O-tolylcarbamoyl)naphthalen-3-yl 2-chloroacetate |
| IUPAC Name | [3-[(2-methylphenyl)carbamoyl]naphthalen-2-yl] 2-chloroacetate |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.8 g/mol |
| InChI | InChI=1S/C20H16ClNO3/c1-13-6-2-5-9-17(13)22-20(24)16-10-14-7-3-4-8-15(14)11-18(16)25-19(23)12-21/h2-11H,12H2,1H3,(H,22,24) |
| InChI Key | FMVKYSCWHDVMGO-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2OC(=O)CCl |
| Synonyms | naphthol AS-D chloroacetate |
| Canonical SMILES | CC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2OC(=O)CCl |