2-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside
2-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a chromogenic substrate used for staining and diagnostic purposes. It is a ligand that has been shown to bind to certain enzymes and can be used for the detection of those enzymes. This product is also a chemiluminescence substrate, which can be used in bioluminescent reactions.
CAS Number |
131531-82-3 |
Product Name |
2-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
IUPAC Name |
N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-naphthalen-2-yloxyoxan-3-yl]acetamide |
Molecular Formula |
C18H21NO6 |
Molecular Weight |
347.4 g/mol |
InChI |
InChI=1S/C18H21NO6/c1-10(21)19-15-17(23)16(22)14(9-20)25-18(15)24-13-7-6-11-4-2-3-5-12(11)8-13/h2-8,14-18,20,22-23H,9H2,1H3,(H,19,21)/t14-,15-,16-,17-,18-/m1/s1 |
InChI Key |
QKMSGRRTZKSWCS-DUQPFJRNSA-N |
SMILES |
CC(=O)NC1C(C(C(OC1OC2=CC3=CC=CC=C3C=C2)CO)O)O |
Canonical SMILES |
CC(=O)NC1C(C(C(OC1OC2=CC3=CC=CC=C3C=C2)CO)O)O |
Isomeric SMILES |
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=CC3=CC=CC=C3C=C2)CO)O)O |
CAS No: 131531-82-3
Synonyms: 2-Naphthyl N-acetyl-b-D-glucosaminide
MDL No: MFCD08703861
Chemical Formula: C18H21NO6
Molecular Weight: 347.36
|