
Request a quote
Catalog No: A10GD-4393
Cas No: 72732-54-8
Properties: Mol Formula: C11H13NO7, Mol Weight: 271.22
IUPAC Name: (2R,3R,4S,5S)-2-(4-nitrophenoxy)oxane-3,4,5-triol
Synonym: 4-Nitrophenyl-Beta-L-arabinopyranoside, (2R,3R,4S,5S)-2-(4-Nitrophenoxy)tetrahydro-2H-pyran-3,4,5-triol, 4-Nitrophenyl b-L-arabinopyranoside
4-Nitrophenyl b-L-arabinopyranoside is a substrate molecule for the lactococci. It can be used to measure turbidity and as an indicator of metabolic activity. The substrate has been shown to have interspecific activity with cytoplasmic hydrolase family enzymes, such as metamorphic, fertility, and pycnoporus. 4-Nitrophenyl b-L-arabinopyranoside is also active against Leuconostoc mesenteroides, which is a type of bacteria found in the intestines and vagina. This chemical can be detected using the leucocyte agglutination test and has no detectable activity against Lactobacillus acidophilus or Japonica strains.
4-Nitrophenyl beta-L-arabinopyranoside (pNPG) is a colorless to pale yellow crystalline powder that is widely used in scientific experiments due to its ability to detect the presence and activity of enzymes. It serves as a substrate for ?-galactosidase, an enzyme that catalyzes the breakdown of lactose into glucose and galactose. In this paper, we will discuss the definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of 4-Nitrophenyl beta-L-arabinopyranoside.
Definition and Background:
4-Nitrophenyl beta-L-arabinopyranoside is a synthetic chromogenic substrate that is widely used in scientific experiments. It is a colorless to pale yellow crystalline powder with a molecular formula of C12H15NO8 and a molecular weight of 301.25 g/mol. pNPG serves as a substrate for ?-galactosidase, an enzyme that catalyzes the breakdown of lactose into glucose and galactose. It is used to detect the presence and activity of ?-galactosidase in various scientific experiments.
Physical and Chemical Properties:
4-Nitrophenyl beta-L-arabinopyranoside is a crystalline powder that is soluble in water, ethanol, and dimethyl sulfoxide (DMSO). Its melting point is 187-188?C, and it has a pH range of 6.0-8.0. pNPG is stable at room temperature and does not undergo any significant changes in physical or chemical properties when exposed to light or air.
Synthesis and Characterization:
4-Nitrophenyl beta-L-arabinopyranoside can be synthesized by various methods, including acid-catalyzed reaction, Lewis acid-catalyzed reaction, and enzymatic synthesis. The acid-catalyzed reaction involves the reaction of arabinose with 4-nitrophenol in the presence of an acid catalyst such as hydrochloric acid. The Lewis acid-catalyzed reaction involves the reaction of arabinose with 4-nitrophenol in the presence of a Lewis acid catalyst such as zinc chloride. Enzymatic synthesis involves the reaction of arabinose with 4-nitrophenol in the presence of ?-galactosidase.
The synthesized pNPG is characterized by various analytical techniques, including nuclear magnetic resonance (NMR) spectroscopy, mass spectrometry, and infrared (IR) spectroscopy. These techniques provide information about the chemical structure and purity of the synthesized pNPG.
Analytical Methods:
Various analytical methods are used to detect the presence and activity of ?-galactosidase using pNPG as a substrate. These methods include colorimetric assays, fluorometric assays, and spectrophotometric assays. The colorimetric assays involve the measurement of absorbance at a fixed wavelength, typically at 405 nm, to determine the formation of the yellow product.
Biological Properties:
4-Nitrophenyl beta-L-arabinopyranoside is widely used in scientific experiments to detect the presence and activity of ?-galactosidase. ?-galactosidase is an enzyme that catalyzes the breakdown of lactose into glucose and galactose. It is present in various organisms, including bacteria, yeast, and mammals. pNPG is also used to detect the activity of ?-glucuronidase, another enzyme that catalyzes the hydrolysis of glycosidic bonds.
Toxicity and Safety in Scientific Experiments:
4-Nitrophenyl beta-L-arabinopyranoside is considered safe to use in scientific experiments at the recommended concentrations. It is not mutagenic or carcinogenic and does not have any significant toxic effects on living organisms.
Applications in Scientific Experiments:
4-Nitrophenyl beta-L-arabinopyranoside has various applications in scientific experiments, including the detection of ?-galactosidase and ?-glucuronidase activity, the evaluation of enzyme inhibitors, and the study of enzyme kinetics. It is also used in the development of rapid diagnostic tests for various diseases.
Current State of Research:
Research on 4-Nitrophenyl beta-L-arabinopyranoside is ongoing, with various studies focusing on its use in enzymatic assays, the development of new analytical methods, and its potential applications in various fields, including biotechnology, microbiology, and medical diagnostics.
Potential Implications in Various Fields of Research and Industry:
4-Nitrophenyl beta-L-arabinopyranoside has significant potential applications in various fields of research and industry, including biotechnology, microbiology, and medical diagnostics. Its ability to detect enzyme activity makes it a valuable tool in the development of new drugs and therapies for various diseases. It is also used in the production of various enzymes and proteins for biotechnological applications.
Limitations and Future Directions:
Despite its significant potential, 4-Nitrophenyl beta-L-arabinopyranoside has some limitations, including its relatively low sensitivity and specificity in detecting enzyme activity. Further research is needed to develop more sensitive and specific assays based on pNPG. Future directions of research could include the development of new analytical methods, the optimization of enzymatic assays, and the identification of novel applications for pNPG in various fields of research and industry.
Conclusion:
In conclusion, 4-Nitrophenyl beta-L-arabinopyranoside is a valuable tool in scientific experiments for the detection of enzyme activity. It has various applications in biotechnology, microbiology, and medical diagnostics, and its potential implications in these fields are significant. Further research is needed to optimize its use and develop new applications for pNPG.
| CAS Number | 72732-54-8 |
| Product Name | 4-Nitrophenyl beta-L-arabinopyranoside |
| IUPAC Name | (2R,3R,4S,5S)-2-(4-nitrophenoxy)oxane-3,4,5-triol |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.22 g/mol |
| InChI | InChI=1S/C11H13NO7/c13-8-5-18-11(10(15)9(8)14)19-7-3-1-6(2-4-7)12(16)17/h1-4,8-11,13-15H,5H2/t8-,9-,10+,11+/m0/s1 |
| InChI Key | MLJYKRYCCUGBBV-UKKRHICBSA-N |
| SMILES | C1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |
| Canonical SMILES | C1C(C(C(C(O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |
| Isomeric SMILES | C1[C@@H]([C@@H]([C@H]([C@H](O1)OC2=CC=C(C=C2)[N+](=O)[O-])O)O)O |
Synonyms: PNP-arabinoside MDL No: MFCD00069787 Chemical Formula: C11H13NO7 Molecular Weight: 271.22 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
10 in stock
10 in stock
10 in stock
IUPAC:Fuc(a1-2)[Gal(a1-3)]Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)b-Glc, G63238VS
10 in stock
Not a member? Create an account
Already got an account? Sign in here