2-Dodecylresorufin
2-Dodecyl-7-hydroxy-3H-phenoxazin-3-one
2-Dodecylresorufin is a fluorescent probe that reacts with the hydroxyl radicals in the cell, which are generated by the enzyme superoxide dismutase. 2-Dodecylresorufin can be used to measure reactive oxygen species (ROS) and ROS-induced cellular damage. It is also used to study oxidative stress in vitro. The chemical structure of 2-dodecylresorufin contains a linker arm that provides a reversible linkage to the cell surface, allowing for extracellular measurements of reactive oxygen species (ROS). This compound has been shown to have high reactivity, making it useful for studying population dynamics and fluorescent techniques.
CAS Number | 147662-88-2 |
Product Name | 2-Dodecylphenoxazin-3-one |
IUPAC Name | 2-dodecylphenoxazin-3-one |
Molecular Formula | C24H31NO3 |
Molecular Weight | 381.51 |
InChI | InChI=1S/C24H31NO2/c1-2-3-4-5-6-7-8-9-10-11-14-19-17-21-24(18-22(19)26)27-23-16-13-12-15-20(23)25-21/h12-13,15-18H,2-11,14H2,1H3 |
SMILES | CCCCCCCCCCCCC1=CC2=NC3=CC=CC=C3OC2=CC1=O |