5-Bromo-4-chloro-1H-indol-3-yl-b-D-glucuronide
X-Glucuronide; X-GlcA
5-Bromo-4-chloro-3-indolyl ?-D-glucuronide (BCIG) is an chromogenic enzyme substrate used to detect the presence of glucuronidase enzyme activity. The reaction occurs when BCIG reacts with the enzyme beta-glucuronidase yielding an intense blue color. It is used in a variety of biochemical and biomedical applications, such as the detection of pathogenic bacteria, the diagnosis of genetic disorders, and the isolation of recombinant proteins.
CAS Number | 18656-89-8 |
Product Name | 5-Bromo-4-chloro-3-indolyl beta-d-glucuronide |
IUPAC Name | (2S,3S,4S,5R,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
Molecular Formula | C14H13BrClNO7 |
Molecular Weight | 422.61 g/mol |
InChI | InChI=1S/C14H13BrClNO7/c15-4-1-2-5-7(8(4)16)6(3-17-5)23-14-11(20)9(18)10(19)12(24-14)13(21)22/h1-3,9-12,14,17-20H,(H,21,22)/t9-,10-,11+,12-,14+/m0/s1 |
InChI Key | DHJFFLKPAYHPHU-BYNIDDHOSA-N |
SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O)Cl)Br |
Synonyms | 5-bromo-4-chloro-3-indolyl-beta-D-glucuronide cyclohexylammonium salt, 5-bromo-4-chloro-3-indolylglucuronide, BCI-3 Glud |
Canonical SMILES | C1=CC(=C(C2=C1NC=C2OC3C(C(C(C(O3)C(=O)O)O)O)O)Cl)Br |
Isomeric SMILES | C1=CC(=C(C2=C1NC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)Cl)Br |