Methyla-D-ribofuranoside

Request a quote

Catalog No: A10GD-4937
Cas No: 52485-92-4
Properties: Mol Formula: C6H12O5, Mol Weight: 164.16
IUPAC Name: 2-(hydroxymethyl)-5-methoxyoxolane-3,4-diol
Synonym: (2R,3S,4R,5S)-2-(HYDROXYMETHYL)-5-METHOXYOXOLANE-3,4-DIOL, Methyl pentofuranoside #, Methylalfa-D-ribofuranoside

+

  Share
Guaranteed Safe CheckoutTrust

Methyl a-D-ribofuranoside is a molecule that belongs to the group of conformers. It is a planar molecule, with its atoms in an orderly arrangement. The conformation of this molecule can be changed by rotating around the C-C bond, which has energies and displacements. Molecular orbital theory predicts that the conformation of methyl a-D-ribofuranoside is determined by the electron correlation between all atomic orbitals. The molecular structure of methyl a-D-ribofuranoside can be determined using spectroscopic methods, such as infrared and nuclear magnetic resonance spectroscopy. Coupling constants are used to measure how strongly two or more groups in a molecule are coupled together, while constants are used to measure the energy levels and frequencies in vibrational spectroscopy.

CAS No52485-92-4
MDL NoMFCD00069677
Chemical FormulaC6H12O5
Molecular Weight164.156 g/mol
Smiles

CO[C@@H]1[C@@H]([C@@H]([C@H](O1)CO)O)O

2. MSDS

3. Tech Data Sheets/Manuals

Size

1 G, 100 MG, 5 G, Other

My Cart
Close Wishlist
Close Recently Viewed
Categories