(S)-(+)-2,3-O-Isopropylideneglycerol ?
1,2-O-Isopropylidene-sn-glycerol (1,2-OIPG) is a synthetic molecule. It is synthesized from potassium thioacetate and chloride in an organic solvent with hexadecyl methanesulfonate as the catalyst. The product is obtained by intramolecular hydrogenation of the glyceride to produce 1,2-OIPG. This compound has been used as a strategy to generate hydrogen bonds in asymmetric synthesis, for example in the formation of d-mannitol with activated hydrogen bonds. The compound also has potential applications in the production of fatty acids.
| CAS Number | 22323-82-6 |
| Product Name | (S)-(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol |
| IUPAC Name | [(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methanol |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.15 g/mol |
| InChI | InChI=1S/C6H12O3/c1-6(2)8-4-5(3-7)9-6/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
| InChI Key | RNVYQYLELCKWAN-YFKPBYRVSA-N |
| SMILES | CC1(OCC(O1)CO)C |
| Synonyms | (S)-(+)-1,2-O-Isopropylideneglycerol; (S)-2,2-Dimethyl-[1,3]-dioxolan-4-yl)-methanol; (S)-Solketal; (S)-(+)-Solketal |
| Canonical SMILES | CC1(OCC(O1)CO)C |
| Isomeric SMILES | CC1(OC[C@@H](O1)CO)C |
CAS No: 22323-82-6 Synonyms: (S)-(+)-2,2-Dimethyl-1,3-dioxolane-4-methanol(S)-(+)-Solketal MDL No: MFCD00063239 Chemical Formula: C6H12O3 Molecular Weight: 132.15 |