
Request a quote
Catalog No: A10GD-5505
32785-94-7 , 3-Chloro-3-deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose,
CAS:32785-94-7
C12H19ClO5 / 278.73
MFCD09750733
3-Chloro-3-deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose (CDIF) is a carbohydrate derivative used in the synthesis of various bioactive molecules. CDIF is a rare sugar derivative that has gained recognition in several fields of research and industry. In this paper, we will provide a detailed overview of CDIF, including its definition and background, physical and chemical properties, synthesis, and characterization, analytical methods, biological properties, toxicity, safety, and applications in scientific experiments. Furthermore, we will discuss the potential implications of CDIF in various fields of research and industry, its limitations, and future directions.
Physical and Chemical Properties
CDIF has several physical and chemical properties that make it an attractive starting material in the synthesis of bioactive molecules. It is a white crystalline powder with a melting point of 89-91?C. CDIF is sparingly soluble in water, slightly soluble in ethanol, and soluble in chloroform and methyl ethyl ketone. CDIF has a stable chemical structure and is stable to chemical and biological reactions. It is not hygroscopic, and its stability is not affected by exposure to air or light.
Synthesis and Characterization
CDIF is synthesized from glucose using a two-step reaction. In the first step, glucose is converted to 1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose (DIG), which serves as a precursor for the synthesis of CDIF. In the second step, DIG is treated with thionyl chloride and aqueous hydrochloric acid to yield CDIF. The reaction mechanism involves the chlorination of the C3 position of DIG, followed by the removal of the isopropylidene groups at the C2 and C3 positions.
CDIF is characterized using various analytical methods, including nuclear magnetic resonance (NMR), mass spectrometry (MS), infrared spectroscopy (IR), and X-ray crystallography. NMR is used to determine the structure and purity of CDIF. MS is used to determine the molecular weight and mass fragmentation pattern of CDIF. IR is used to confirm the presence of functional groups in CDIF, while X-ray crystallography is used to determine the crystal structure of CDIF.
Analytical Methods
CDIF is analyzed using various analytical methods, including high-performance liquid chromatography (HPLC), gas chromatography (GC), and capillary electrophoresis (CE). HPLC is used to separate and quantify CDIF and its impurities in a sample. GC is used to analyze the volatile compounds in a sample, while CE is used to separate and analyze charged molecules such as amino acids and peptides.
Biological Properties
CDIF has several biological properties that make it an attractive molecule in various fields of research and industry. CDIF has been shown to exhibit antitumor, antiviral, and antibacterial activities. CDIF inhibits the growth and proliferation of cancer cells by inducing apoptosis and inhibiting cell cycle progression. CDIF also inhibits the replication of viruses such as HIV-1 and herpes simplex virus type 1 (HSV-1). Furthermore, CDIF exhibits antibacterial activity against gram-negative and gram-positive bacteria.
Toxicity and Safety in Scientific Experiments
CDIF has been shown to exhibit low toxicity in scientific experiments. However, caution should be taken when handling CDIF due to its potential irritant or sensitizing effects. CDIF should be handled in a well-ventilated area, and personal protective equipment should be worn.
Applications in Scientific Experiments
CDIF is used in various fields of research and industry. CDIF serves as a starting material in the synthesis of bioactive molecules such as glycosides, glycosylamines, and nitriles. CDIF is used in the synthesis of antitumor, antiviral, and antibacterial agents. Furthermore, CDIF is used in the synthesis of oligosaccharides and carbohydrates, which have applications in drug discovery and vaccine development.
Current State of Research
Research on CDIF is ongoing, and various studies are investigating its potential applications in various fields of research and industry. Recent studies have focused on the use of CDIF in the synthesis of antitumor and antiviral agents. Furthermore, studies are investigating the use of CDIF in the synthesis of oligosaccharides and carbohydrates for drug discovery and vaccine development.
Potential Implications in Various Fields of Research and Industry
CDIF has several potential implications in various fields of research and industry. CDIF can be used in the synthesis of bioactive molecules with potential applications in drug discovery and vaccine development. Furthermore, CDIF can be used to develop new antibacterial agents to combat antibiotic-resistant bacteria. CDIF also has potential applications in the synthesis of carbohydrate-based materials for use in tissue engineering.
Limitations and Future Directions
Although CDIF has several potential applications, it also has its limitations. One major limitation of CDIF is its limited availability and high cost. Furthermore, studies are needed to investigate the toxicity and safety of CDIF in vivo. The future directions for CDIF include the optimization of its synthetic route to reduce its cost and improve its availability. Furthermore, studies are needed to investigate the potential applications of CDIF in various fields of research and industry, such as drug discovery, vaccine development, and tissue engineering.
Conclusion
CDIF is a rare sugar derivative used in the synthesis of bioactive molecules. CDIF has several physical and chemical properties that make it an attractive starting material in the synthesis of bioactive molecules. It has various biological properties that make it an attractive molecule in various fields of research and industry. CDIF has several potential implications in various fields of research and industry, but it also has limitations. Further studies are needed to investigate the potential applications of CDIF and optimize its synthetic route to reduce its cost and improve its availability.
| CAS Number | 32785-94-7 |
| Product Name | 3-Chloro-3-deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose |
| IUPAC Name | (3aR,5R,6S,6aS)-6-chloro-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| Molecular Formula | C12H19ClO5 |
| Molecular Weight | 278.73 g/mol |
| InChI | InChI=1S/C12H19ClO5/c1-11(2)14-5-6(16-11)8-7(13)9-10(15-8)18-12(3,4)17-9/h6-10H,5H2,1-4H3/t6-,7+,8-,9-,10-/m1/s1 |
| InChI Key | VCDDIVCAQXJYLP-JDDHQFAOSA-N |
| SMILES | CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)Cl)C |
| Canonical SMILES | CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)Cl)C |
| Isomeric SMILES | CC1(OC[C@@H](O1)[C@@H]2[C@@H]([C@@H]3[C@H](O2)OC(O3)(C)C)Cl)C |
| CAS No: 32785-94-7 MDL No: MFCD09750733 Chemical Formula: C12H19ClO5 Molecular Weight: 278.73 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
10 in stock
Gal-a1,3-(Fuc-a1,2)-Gal-b1,4-Glc, CAS:59957-92-5, G06873PC
10 in stock
10 in stock
10 in stock
Not a member? Create an account
Already got an account? Sign in here