Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-glucopyranoside is a synthetic compound that has been shown to be an inhibitor of the receptor for the proinflammatory cytokine TNF. It has been proposed as a possible treatment for chronic kidney disease, acute phase, and neurodegenerative diseases such as chronic pain. Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-glucopyranoside is an inhibitor of factor receptors and inhibits the activation of NF?B in a dose dependent manner. This inhibition leads to decreased production of proinflammatory cytokines such as TNF.
Methyl 2,3-Di-O-benzoyl-4,6-O-benzylidene-alpha-D-glucopyranoside, also known as MDBGN, is a glycoside compound that has attracted a lot of attention in the scientific community due to its potential use in various fields of research and industry. In this paper, we will discuss the definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of MDBGN.
Synthesis and Characterization
MDBGN can be synthesized from glucose by sequential acylation of the primary hydroxyl functions using benzoyl chloride and benzaldehyde in the presence of a Lewis acid catalyst. The resulting MDBGN is then purified by column chromatography.
MDBGN can be characterized using various techniques, including infrared spectroscopy, nuclear magnetic resonance (NMR), and mass spectrometry.
| CAS Number | 6748-91-0 |
| Product Name | Methyl 2,3-Di-O-benzoyl-4,6-O-benzylidene-alpha-D-glucopyranoside |
| IUPAC Name | (7-benzoyloxy-6-methoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl) benzoate |
| Molecular Formula | C28H26O8 |
| Molecular Weight | 490.5 g/mol |
| InChI | InChI=1S/C28H26O8/c1-31-28-24(35-26(30)19-13-7-3-8-14-19)23(34-25(29)18-11-5-2-6-12-18)22-21(33-28)17-32-27(36-22)20-15-9-4-10-16-20/h2-16,21-24,27-28H,17H2,1H3 |
| InChI Key | CGMUHSNJRXPSSA-UHFFFAOYSA-N |
| SMILES | COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| Canonical SMILES | COC1C(C(C2C(O1)COC(O2)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| CAS No: 6748-91-0 MDL No: MFCD02167693 Chemical Formula: C28H26O8 Molecular Weight: 490.5 |