| CAS Number | 7355-18-2 |
| Product Name | (2S,3R,4S,5S,6S)-6-(methoxycarbonyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5,6-tetraacetyloxyoxane-2-carboxylate |
| Molecular Formula | C15H20O11 |
| Molecular Weight | 376.31 g/mol |
| InChI | InChI=1S/C15H20O11/c1-6(16)22-10-11(23-7(2)17)13(24-8(3)18)15(25-9(4)19)26-12(10)14(20)21-5/h10-13,15H,1-5H3/t10-,11-,12-,13+,15+/m0/s1 |
| InChI Key | DPOQCELSZBSZGX-XOBFJNJYSA-N |
| SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C |
| Synonyms | Methyl 1,2,3,4-Tetra-O-Acetyl-D-glucopyranosiduronate; NSC 16925; NSC 82042; |
| Canonical SMILES | CC(=O)OC1C(C(OC(C1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C |
| Isomeric SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC(=O)C)C(=O)OC)OC(=O)C |
| CAS No: 7355-18-2 Synonyms: Methyl 1,2,3,4-tetra-O-acetyl-b-D-glucopyranuronateMethyl(1,2,3,4-tetra-O-acetyl-b-D-glucopyranoside)uronate MDL No: MFCD00069834 Chemical Formula: C15H20O11 Molecular Weight: 376.31 | In Stock. ?? |
|
COA:
Product name: Methyl 1,2,3,4-Tetra-O-acetyl-?-D-glucuronate
CAS: 7355-18-2 M.F.: C15H20 O11 M.W.: 376.31
Items | Standards | Results |
Appearance | White or off-white powder | Complies |
Solubility | Clear to very slightly hazy colorless to faint yellow solution in CHCl3 | Complies |
MS and NMR | Should comply | Comply |
Identification | IR and TLC | Comply |
Optical activity [a ] 24D (CHCl3) | From 7? to 8? | 7.8? |
Loss weight on dryness | Max. 0.5% | 0.2% |
Residue on ignition | Max. 0.5% | 0.1% |
Alpha-Isomer | Max. 1% | 0.05% |
Assay | Min. 98% | 99.4% |
References:
1. Ramu K, Baker JK, J. Med. Chem. 1995, 38, p1911-1921