
Request a quote
Catalog No: A10GD-5712
41545-55-5, Penta-O-benzoyl-a-D-galactose,
CAS:41545-55-5
C41H32O11 / 700.69
MFCD08274509
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate is a type of organic compound that has gained significant attention over the years due to its unique properties and potential implications in a variety of fields. In this paper, we will explore various aspects of this compound, including its definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Definition and Background
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate is a type of organic compound that belongs to the group of esters. It is a white crystalline powder that is soluble in chloroform, methanol, and ethanol, and slightly soluble in water. This compound is also known by several other names, including DDAIP, DDAIB, and CL109.
This compound was first synthesized by F. Diederich and H. C. Hanggi in 1988. Since then, it has been used in a variety of applications, including as a building block in the synthesis of other organic compounds, as a chiral auxiliary for enantioselective synthesis, and as a probe for supramolecular chemistry studies.
Synthesis and Characterization
There are several methods that can be used to synthesize [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate. One of the most common methods involves the use of DMAP (4-dimethylaminopyridine) as a catalyst. The reaction is typically carried out in a solvent such as dichloromethane, and it involves the reaction between benzoyl chloride and 2,3,4,5,6-penta-O-benzoyl-D-gluconic acid lactone.
The synthesized compound can be characterized using various techniques, including nuclear magnetic resonance (NMR) spectroscopy, infrared spectroscopy (IR), mass spectrometry, and X-ray crystallography. NMR and IR spectroscopy are the most common techniques used to characterize the compound.
Analytical Methods
There are several analytical methods that can be used to detect and quantify [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate. Gas chromatography (GC), high-performance liquid chromatography (HPLC), and UV-Vis spectroscopy are some of the most commonly used methods. These methods are sensitive, accurate, and precise, and they can be used to detect even small amounts of the compound in a sample.
Biological Properties
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate has been shown to exhibit several biological properties that make it useful in various applications. For example, it has been shown to have antifungal and antibacterial properties, and it can also inhibit the growth of cancer cells in vitro.
Toxicity and Safety in Scientific Experiments
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate is generally considered to be non-toxic, and it is safe to use in scientific experiments. However, it is important to follow proper safety protocols when handling the compound to avoid accidental exposure.
Applications in Scientific Experiments
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate has several important applications in scientific experiments. For example, it can be used as a building block in the synthesis of other organic compounds, as a chiral auxiliary for enantioselective synthesis, and as a probe for supramolecular chemistry studies.
Current State of Research
Researchers are currently exploring various aspects of [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate, including its potential use as a biomaterial and in the development of new drugs. There is also ongoing research into the compound’s physical and chemical properties, the development of new analytical methods for detecting and quantifying the compound, and the identification of new applications for the compound.
Potential Implications in Various Fields of Research and Industry
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate has several potential implications in various fields of research and industry. For example, it could be used as a biomaterial for tissue engineering and drug delivery applications, as a chiral auxiliary for enantioselective synthesis, and as a probe for supramolecular chemistry studies. The compound’s antibacterial and antifungal properties could also make it useful in the development of new drugs.
Limitations and Future Directions
There are several limitations to research on [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate. One limitation is that the compound is relatively expensive and difficult to synthesize. Another potential limitation is that it may not be suitable for certain applications due to its physical and chemical properties.
Despite these limitations, there are several exciting future directions for research on [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate. For example, researchers could investigate the compound’s potential use as a biomaterial and in the development of new drugs. There is also potential to explore the compound’s physical and chemical properties further and to identify new applications for the compound in various fields of research and industry.
Conclusion
[(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate is a unique organic compound that has generated significant interest in the scientific community due to its various properties and potential applications in a variety of fields. This paper has provided an overview of the compound’s definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions. With ongoing research, the potential of this compound will continue to be explored and understood.
| CAS Number | 41545-55-5 |
| Product Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5,6-tetrabenzoyloxyoxan-2-yl]methyl benzoate |
| Molecular Formula | C41H32O11 |
| Molecular Weight | 700.69 g/mol |
| InChI | InChI=1S/C41H32O11/c42-36(27-16-6-1-7-17-27)47-26-32-33(49-37(43)28-18-8-2-9-19-28)34(50-38(44)29-20-10-3-11-21-29)35(51-39(45)30-22-12-4-13-23-30)41(48-32)52-40(46)31-24-14-5-15-25-31/h1-25,32-35,41H,26H2/t32-,33+,34+,35-,41-/m1/s1 |
| InChI Key | JJNMLNFZFGSWQR-RPHMGUFOSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@@H]([C@@H]([C@H]([C@H](O2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5)OC(=O)C6=CC=CC=C6 |
| CAS No: 41545-55-5 MDL No: MFCD08274509 Chemical Formula: C41H32O11 Molecular Weight: 700.69 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
10 in stock
Catalog No: CG-OS03019
CAS No: 13007-32-4
Synonyms: Galβ1-4GlcNAcβ1-3Galβ1-4Glc; LNnT; neo-LNT
Molecular Formula: C₂₆H₄₅NO₂₁
Molecular Weight: 707.63 g/mol
Available Pack Sizes: Research quantities (mg to g scale)
10 in stock
IUPAC:Fuc(a1-2)[Gal(a1-3)]Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)b-Glc, G63238VS
10 in stock
Catalog No: G01534TU
CAS No: 64309-01-9
Molecular Formula: C₅₂H₈₈N₂O₃₉
Molecular Weight: 1365.25 g/mol
Packaging: Available in research quantities
10 in stock
Not a member? Create an account
Already got an account? Sign in here