1-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside
1-Naphthyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a chromogenic substrate commonly used to assay the activity of enzymes that cleave N-acetyl-beta-D-glucosaminide, such as beta-N-acetylglucosaminidase. Upon cleavage by the enzyme of interest, the substrate releases a yellow-colored 1-naphthylamine, which can be measured spectrophotometrically. This substrate is widely used in biomedical research and drug discovery for studying lysosomal storage disorders, bacterial infections, and neurological diseases.
| CAS Number | 10329-98-3 |
| Product Name | 1-Naphthyl 2-acetamido-2-deoxy-beta-D-glucopyranoside |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-naphthalen-1-yloxyoxan-3-yl]acetamide |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.4 g/mol |
| InChI | InChI=1S/C18H21NO6/c1-10(21)19-15-17(23)16(22)14(9-20)25-18(15)24-13-8-4-6-11-5-2-3-7-12(11)13/h2-8,14-18,20,22-23H,9H2,1H3,(H,19,21)/t14-,15-,16-,17-,18-/m1/s1 |
| InChI Key | QJRYPNZYBXWKEV-DUQPFJRNSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC3=CC=CC=C32)CO)O)O |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC3=CC=CC=C32)CO)O)O |
| Isomeric SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=CC=CC3=CC=CC=C32)CO)O)O |
CAS No: 10329-98-3
Synonyms: 1-Naphthyl N-acetyl-b-D-glucosaminide
MDL No: MFCD00051151
Chemical Formula: C18H21NO6
Molecular Weight: 347.36 |