1-Naphthyl a-D-glucopyranoside
1-Naphthyl a-D-glucopyranoside is a chromogenic substrate used to detect the presence of enzymes that catalyze the hydrolysis of glycosidic bonds, such as alpha-glucosidase. When the substrate is cleaved by the enzyme, it produces a colored product that can be visualized and quantified.
| CAS Number | 208647-48-7 |
| Product Name | 1-Naphthyl alpha-D-glucopyranoside |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-naphthalen-1-yloxyoxane-3,4,5-triol |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.314 |
| InChI | InChI=1S/C16H18O6/c17-8-12-13(18)14(19)15(20)16(22-12)21-11-7-3-5-9-4-1-2-6-10(9)11/h1-7,12-20H,8H2/t12-,13-,14+,15-,16+/m1/s1 |
| InChI Key | CVAOQMBKGUKOIZ-LJIZCISZSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2OC3C(C(C(C(O3)CO)O)O)O |
CAS No: 208647-48-7
Synonyms: a-Naphthyl-a-D-glucosidea-Nap-a-D-Glc
MDL No: MFCD04966779
Chemical Formula: C16H18O6
Molecular Weight: 306.31 | |