
Request a quote
Catalog No: A10GD-5741
3891-59-6 , 2,3,4,5,6-Penta-O-acetyl-D-glucopyranose,
CAS:3891-59-6
C16H22O11/ 390.34
MFCD00080787
Glucose pentaacetate is a chemical compound that has attracted the attention of many researchers due to its unique physical and chemical properties. This paper provides an in-depth analysis of glucose pentaacetate, focusing on its definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity, safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Definition and Background
Glucose pentaacetate, commonly known as phenyl glucoside, is an acetylated derivative of glucose that has five acetyl groups attached to the primary hydroxyl groups of glucose. It is a white crystalline solid with a molecular formula of C16H22O11. Glucose pentaacetate is soluble in organic solvents such as acetone, chloroform, and ether but insoluble in water. It has a melting point of 128-130?C and a boiling point of 397.9?C.
Glucose pentaacetate was first synthesized in the late 1800s by acetylating glucose with acetic anhydride in the presence of an acid catalyst. Since then, it has been used in various fields of research and industry, such as in the production of pharmaceuticals, food additives, and fragrances.
Physical and Chemical Properties
Glucose pentaacetate has several physical and chemical properties that make it unique and suitable for specific applications. It is a stable compound that does not decompose easily under normal conditions. Its molecular weight is 390.34 g/mol, and it has a density of 1.24 g/cm3.
The chemical structure of glucose pentaacetate comprises glucose molecules that are linked through acetyl groups. This structure makes it resistant to hydrolysis and oxidation, which are typical reactions that glucose undergoes in the presence of water and air. The five acetyl groups attached to the glucose molecule make it less polar than glucose, which makes it more soluble in organic solvents than water.
Synthesis and Characterization
Glucose pentaacetate can be synthesized by acetylating glucose with acetic anhydride in the presence of an acid catalyst such as sulfuric acid. The reaction produces glucose pentaacetate and acetic acid as a byproduct. The synthesis process involves mixing glucose and acetic anhydride in a flask and heating the mixture under reflux for several hours. The resulting product is then purified by recrystallization.
The characterization of glucose pentaacetate involves various identification techniques such as nuclear magnetic resonance (NMR), mass spectrometry (MS), and Fourier-transform infrared (FTIR) spectroscopy. NMR is used to determine the chemical shifts of the different protons in the molecule, which can be used to identify the compound. MS is used to determine the molecular weight of the compound, while FTIR spectroscopy is used to identify the functional groups present in the molecule.
Analytical Methods
There are various analytical methods used to detect and quantify glucose pentaacetate in different samples. These methods include high-performance liquid chromatography (HPLC), gas chromatography (GC), and capillary electrophoresis (CE).
HPLC is the most widely used method for the detection and quantification of glucose pentaacetate. It involves injecting a sample into a column packed with a stationary phase and a mobile phase that carries the sample through the column. The stationary phase separates the different components of the sample based on their chemical properties, and the detector detects the glucose pentaacetate as it elutes from the column.
GC is a method that involves separating the different components of a sample by volatilization and subsequent chromatography. The method is suitable for samples that are volatile and thermally stable. CE is a method that uses high voltage to separate the different components of a sample based on their size and charge.
Biological Properties
Glucose pentaacetate has several biological properties that make it suitable for various applications in the pharmaceutical and biotechnology industries. It has been shown to have anti-inflammatory, antibacterial, and anticancer properties. It also has the ability to inhibit the growth of certain viruses.
Toxicity and Safety in Scientific Experiments
Glucose pentaacetate has low toxicity and is generally considered safe for use in scientific experiments. However, it can cause skin irritation and eye irritation if it comes into contact with the skin or eyes. It should be handled with care to avoid inhalation, ingestion, or skin contact.
Applications in Scientific Experiments
Glucose pentaacetate has several applications in scientific experiments, including biotechnology, pharmaceuticals, and food additives. It is used as an antibacterial agent, antifungal agent, and anticancer agent. It is also used as a food preservative and a flavor enhancer.
Current State of Research
Research on glucose pentaacetate is ongoing, with researchers investigating its potential applications in various fields such as drug delivery, cancer therapy, and food preservation. Researchers are also investigating its potential toxicity and safety issues in various settings.
Potential Implications in Various Fields of Research and Industry
Glucose pentaacetate has several potential implications in various fields of research and industry. Its antibacterial, antifungal, and anticancer properties make it a potential candidate for the treatment of infectious diseases and cancer. Its use as a food preservative and flavor enhancer also has significant implications in the food industry.
Limitations and Future Directions
Despite its unique properties, glucose pentaacetate has limitations that make it unsuitable for certain applications. Its insolubility in water limits its use in aqueous environments, while its high cost and complex synthesis process limits its use in large-scale applications.
Future directions for research on glucose pentaacetate should focus on finding ways to overcome these limitations and develop new applications for the compound. Researchers should also investigate its potential for drug delivery and targeted therapy and explore its use in tissue engineering and regenerative medicine.
| CAS Number | 3891-59-6 |
| Product Name | Glucose pentaacetate |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-6-oxohexyl] acetate |
| Molecular Formula | C16H22O11 |
| Molecular Weight | 390.34 g/mol |
| InChI | InChI=1S/C16H22O11/c1-8(18)23-7-14(25-10(3)20)16(27-12(5)22)15(26-11(4)21)13(6-17)24-9(2)19/h6,13-16H,7H2,1-5H3/t13-,14+,15+,16+/m0/s1 |
| InChI Key | UAOKXEHOENRFMP-ZJIFWQFVSA-N |
| SMILES | CC(=O)OCC(C(C(C(C=O)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Canonical SMILES | CC(=O)OCC(C(C(C(C=O)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Isomeric SMILES | CC(=O)OC[C@H]([C@H]([C@@H]([C@H](C=O)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| CAS No: 83-87-4,3891-59-6 Synonyms: D-Glucose pentaacetate MDL No: MFCD00080787 Chemical Formula: C16H22O11 Molecular Weight: 390.34 |
| References: 1. Dong JQ, Zhang SJ, Wang YG, Chin. Chem. Lett. 2003, Vol14, No9, p904-906 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
10 in stock
IUPAC:Fuc(a1-2)[GalNAc(a1-3)]Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)b-Glc, G82858KU
10 in stock
IUPAC:Fuc(a1-2)[Gal(a1-3)]Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)b-Glc, G63238VS
10 in stock
10 in stock
Not a member? Create an account
Already got an account? Sign in here