2,3,4,6-Tetra-O-benzoyl-D-glucopyranose is an aldehyde that has been synthesized by the oxidation of D-glucofuranose with nitric acid. It has been shown to act as a competitive inhibitor of lipase and c-glycosidases. The acetal group in 2,3,4,6-tetra-O-benzoyl-D-glucopyranose is activated with acetyl chloride to form an acetal derivative. This compound can be used as a chemoenzymatic glycosidic bond formation method for the synthesis of various glycosides.
| CAS Number | 64768-20-3 |
| Product Name | 2,3,4,6-Tetra-O-benzoyl-beta-D-glucopyranose |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
| Molecular Formula | C34H28O10 |
| Molecular Weight | 596.6 g/mol |
| InChI | InChI=1S/C34H28O10/c35-30(22-13-5-1-6-14-22)40-21-26-27(42-31(36)23-15-7-2-8-16-23)28(43-32(37)24-17-9-3-10-18-24)29(34(39)41-26)44-33(38)25-19-11-4-12-20-25/h1-20,26-29,34,39H,21H2/t26-,27-,28+,29-,34-/m1/s1 |
| InChI Key | FCDYAJBVISGNLC-UCDCFHRCSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| Synonyms | 2,3,4,6-tetrabenzoate ?-D-glucopyranose |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(C(O2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| Isomeric SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)OC(=O)C5=CC=CC=C5 |
| CAS No: 64768-20-3 Synonyms: D-Glucopyranose 2,3,4,6-tetrabenzoate MDL No: MFCD00066004 Chemical Formula: C34H28O10 Molecular Weight: 596.60 |