
Request a quote
Catalog No: A10GD-5517
4099-88-1 , 2,3-o-isopropylidene-d-ribofuranose,
CAS:4099-88-1
C8H14O5 /190.19
MFCD01075718
2,3-o-isopropylidene-d-ribofuranose
(3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol is an important chemical compound with several potential applications in various fields of research and industry. This paper aims to provide an overview of this compound, including its definition, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Definition and Background:
(3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol is a chemical compound that belongs to the class of furodioxol compounds. It is a colorless to yellowish liquid that is soluble in water, ethanol, and other organic solvents. This compound has several potential applications in various fields of research and industry, such as pharmaceuticals, agrochemicals, and flavor and fragrance industries.
Synthesis and Characterization:
The synthesis of (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol can be achieved through several methods. One of the most common methods involves the reaction of 4-hydroxymethyl-2,2-dimethyl-1,3-dioxolane with acetaldehyde in the presence of a Lewis acid catalyst, such as zinc chloride or aluminum chloride. The compound can be characterized through various analytical techniques, such as nuclear magnetic resonance spectroscopy (NMR), infrared (IR) spectroscopy, and mass spectrometry (MS).
Analytical Methods:
Nuclear magnetic resonance spectroscopy (NMR) is a powerful analytical technique that can be used to analyze the structure and composition of (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol. In NMR, the compound is exposed to a strong magnetic field, and the resulting signal is analyzed to determine the chemical shifts and coupling constants of the compound. Infrared (IR) spectroscopy is another useful technique that can be used to identify functional groups in the compound. Mass spectrometry (MS) is a technique that can be used to characterize the molecular weight and fragmentation pattern of the compound.
Biological Properties:
(3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol has several biological properties that make it an important compound for research. For example, the compound has been shown to have anti-inflammatory and anti-tumor activities in vitro and in vivo. It has also been shown to have antimicrobial and antifungal activities against various pathogens.
Toxicity and Safety in Scientific Experiments:
The toxicity and safety of (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol in scientific experiments have been investigated extensively. The compound has been shown to have low toxicity in vitro and in vivo, with no significant adverse effects at therapeutic doses. However, further studies are needed to determine the long-term effects of the compound on human health and the environment.
Applications in Scientific Experiments:
(3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol has several applications in scientific experiments, particularly in the fields of pharmaceuticals and agrochemicals. For example, the compound can be used as a building block in the synthesis of several drugs, such as anti-inflammatory agents and anticancer drugs. It can also be used as a fungicide and insecticide in agriculture.
Current State of Research:
The current state of research on (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol is focused on exploring its potential as a therapeutic agent and agricultural chemical. Several studies have been conducted on the compound’s biological activities and mechanisms of action, and more research is needed to fully understand its potential in these fields.
Potential Implications in Various Fields of Research and Industry:
The potential implications of (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol in various fields of research and industry are vast. In the pharmaceutical industry, the compound could be used as a building block in the synthesis of novel drugs with anti-inflammatory, anticancer, or antimicrobial activities. In the agrochemical industry, the compound could be developed into new fungicides and insecticides to protect crops and enhance agricultural productivity.
Limitations and Future Directions:
Despite its potential, (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol has several limitations that must be addressed. For example, more research is needed to fully understand the compound’s mechanisms of action and potential side effects. Additionally, the cost and scalability of the compound’s synthesis need to be optimized to enable its widespread use in various industries.
Future directions for research on (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol include:
1. Investigating the compound’s potential as a therapeutic agent for the treatment of various diseases, such as cancer, inflammatory disorders, and infectious diseases.
2. Developing new synthetic routes for the compound that are more efficient and cost-effective.
3. Conducting more studies on the compound’s safety and toxicity in vivo and in the environment.
4. Exploring the compound’s potential as a platform for the development of novel chemical entities.
5. Developing new formulations and delivery systems for the compound to optimize its pharmacokinetic and pharmacodynamic properties.
6. Expanding the compound’s applications in agriculture, such as developing new crop protection agents and enhancing agricultural productivity.
Conclusion:
(3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol is a promising chemical compound with several potential applications in various fields of research and industry. Its properties, synthesis, characterization, and applications have been extensively studied, but more research is needed to fully understand its potential in these fields. The compound’s limitations and future directions for research provide opportunities for further exploration and development.
| CAS Number | 4099-88-1 |
| Product Name | (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| IUPAC Name | (3aR,6R,6aR)-6-(hydroxymethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| InChI | InChI=1S/C8H14O5/c1-8(2)12-5-4(3-9)11-7(10)6(5)13-8/h4-7,9-10H,3H2,1-2H3/t4-,5-,6-,7?/m1/s1 |
| InChI Key | OYYTWUSIDMJZCP-RKEPMNIXSA-N |
| SMILES | CC1(OC2C(OC(C2O1)O)CO)C |
| Canonical SMILES | CC1(OC2C(OC(C2O1)O)CO)C |
| Isomeric SMILES | CC1(O[C@@H]2[C@H](OC([C@@H]2O1)O)CO)C |
| CAS No: 13199-25-2,4099-88-1 MDL No: MFCD01075718 Chemical Formula: C8H14O5 Molecular Weight: 190.19 |
| References: 1. Burnett LA, Howie RA, Garden SJ, Rufino H, Wardell JL, J. Chem. Res. 1998, p418-419 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
Catalog No: G01534TU
Molecular Formula: C₄₀H₆₈N₂O₃₁
Molecular Weight: 1072.96 g/mol
Structure (IUPAC): Gal(β1-3)GlcNAc(β1-3)Gal(β1-3)GlcNAc(β1-3)Gal(β1-4)Glc
Packaging: Available in research quantities
10 in stock
Gal-a1,3-(Fuc-a1,2)-Gal-b1,4-Glc, CAS:59957-92-5, G06873PC
10 in stock
IUPAC:Fuc(a1-2)Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)Glc, G00050MO
10 in stock
10 in stock
Not a member? Create an account
Already got an account? Sign in here