2-Acetamido-3-O-acetyl-2-deoxy-D-glucopyranose, also known as N-acetylneuraminic acid or sialic acid, is an important biomolecule found in various mammalian and microbial cell surfaces and secretions. It plays a critical role in many biological processes such as cell adhesion, immune response, and signaling, and its structure and properties are highly conserved across different species.
CAS Number |
51449-93-5 |
Product Name |
2-Acetamido-3-O-acetyl-2-deoxy-D-glucopyranose |
IUPAC Name |
[(3R,4R,5S,6R)-3-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] acetate |
Molecular Formula |
C10H17NO7 |
Molecular Weight |
263.24 g/mol |
InChI |
InChI=1S/C10H17NO7/c1-4(13)11-7-9(17-5(2)14)8(15)6(3-12)18-10(7)16/h6-10,12,15-16H,3H2,1-2H3,(H,11,13)/t6-,7-,8-,9-,10?/m1/s1 |
InChI Key |
YNJNXDFAPWSUSI-WWGUJXLXSA-N |
SMILES |
CC(=O)NC1C(C(C(OC1O)CO)O)OC(=O)C |
Synonyms |
2-(Acetylamino)-2-deoxy-D-glucose 3-Acetate; N-Acetyl-glucosamine 3-Acetate; |
Canonical SMILES |
CC(=O)NC1C(C(C(OC1O)CO)O)OC(=O)C |
Isomeric SMILES |
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](OC1O)CO)O)OC(=O)C |
CAS No: 51449-93-5 Synonyms: 2-(Acetylamino)-2-deoxy-D-glucose 3-acetate MDL No: MFCD01320360 Chemical Formula: C10H17NO7 Molecular Weight: 263.24 |