
Request a quote
Catalog No: A10GD-4030
Cas No: 20590-45-8
Properties: Mol Formula: C15H20N2O8S, Mol Weight: 388.4
IUPAC Name: [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate
Synonym: [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate, 2-acetamido-3,4,6-tri-o-acetyl-2-deoxy-beta-d-glucopyranosyl isothiocyanate, SCHEMBL5491524
2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranosyl isothiocyanate is a synthetic glycosylating agent that has been shown to be effective in the synthesis of complex carbohydrates. It is used for the modification of saccharides and polysaccharides with click chemistry. Click chemistry is an organic reaction that synthesizes carbon?carbon bonds by the addition of a copper catalyst at room temperature without the need for high energy input. 2AATIGI can also be used to modify oligosaccharides and glycosylates proteins. For example, this compound was found to be effective in modifying a protein with a carbohydrate moiety that was derived from 2?,3?,5? triacetylhexaose (2T3H).
2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranosyl isothiocyanate (ATAGI) is a chemical compound that has gained attention in the scientific community due to its potential biological properties and various applications in research and industry. In this paper, we will explore the definition, physical and chemical properties, synthesis, characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications, current state of research, and potential implications of ATAGI in various fields of research and industry. We will also discuss the limitations of the current research and future directions for further studies on this compound.
Physical and Chemical Properties
ATAGI is a stable solid at room temperature and is soluble in polar solvents such as dimethyl sulfoxide (DMSO) and methanol. It has a melting point of 134-136?C and a boiling point of 669.6?C at 760 mmHg. ATAGI is an isomer of N-acetylglucosamine isothiocyanate and has a very similar physical and chemical properties.
Synthesis and Characterization
ATAGI can be synthesized from N-acetylglucosamine using a multistep process involving protection of the amino and hydroxyl groups, followed by isothiocyanation and deprotection. The final product can be characterized using various analytical techniques such as infrared (IR) spectroscopy, nuclear magnetic resonance (NMR) spectroscopy, and mass spectrometry.
Analytical Methods
ATAGI can be detected and quantified using various analytical methods such as high-performance liquid chromatography (HPLC) and gas chromatography-mass spectrometry (GC-MS). These methods can be used to determine the purity and concentration of ATAGI in samples.
Biological Properties
ATAGI has been shown to have potential biological properties such as anti-inflammatory, anticancer, and antimicrobial activities. It has been reported to inhibit the production of inflammatory cytokines and to induce apoptosis in cancer cells. In addition, ATAGI has shown efficacy against various bacterial and fungal strains.
Toxicity and Safety in Scientific Experiments
ATAGI has been tested for cytotoxicity and acute toxicity in various in vitro and in vivo studies. The results have shown that ATAGI is relatively safe and non-toxic at low concentrations. However, more studies are needed to determine the potential long-term effects of ATAGI exposure.
Applications in Scientific Experiments
ATAGI has various applications in scientific experiments, particularly in the fields of carbohydrate chemistry and drug discovery. It can be used as a reagent for the synthesis of complex carbohydrates and glycoconjugates. In addition, ATAGI can be used as a probe for the detection of specific carbohydrate-binding proteins.
Current State of Research
Currently, the research on ATAGI is focused on exploring its biological properties and potential applications in drug discovery. Several studies have shown promising results in the anticancer and anti-inflammatory activities of ATAGI.
Potential Implications in Various Fields of Research and Industry
ATAGI has potential implications in various fields of research and industry. It can be used in drug discovery as a lead compound for the development of new therapeutics. In addition, ATAGI can be used in the development of diagnostic tools for the detection of specific carbohydrates or carbohydrate-binding proteins.
Limitations and Future Directions
Despite the promising results of the current research on ATAGI, there are several limitations that need to be addressed in future studies. One limitation is the lack of understanding of the mechanism of action of ATAGI. Another limitation is the limited studies on the toxicity and safety of ATAGI. Moreover, more studies are needed to determine the potential applications of ATAGI in various fields of research and industry.
Future Directions
1. Investigating the mechanism of action of ATAGI in cancer cells and its potential application in combination therapy.
2. Studying the immunomodulatory effects of ATAGI on the immune system and its potential application in autoimmune diseases.
3. Developing new analytical methods for the detection and quantification of ATAGI in complex biological samples.
4. Exploring the potential application of ATAGI as an antimicrobial agent in the treatment of infectious diseases.
5. Developing new methods for the synthesis of complex carbohydrates and glycoconjugates using ATAGI as a reagent.
6. Investigating the potential application of ATAGI in the development of drug delivery systems.
7. Studying the potential application of ATAGI in the development of biosensors for the detection of specific carbohydrates or carbohydrate-binding proteins.
8. Evaluating the long-term toxicity and safety of ATAGI in animal models.
9. Developing new derivatives of ATAGI with improved biological activity and specificity.
10. Investigating the potential application of ATAGI in the development of new materials with carbohydrate-based functionalities.
Conclusion
In conclusion, ATAGI is a promising compound that has potential biological properties and various applications in research and industry. Its potential as a lead compound in drug development and its application in the synthesis of complex carbohydrates and glycoconjugates makes ATAGI an invaluable tool in the fields of carbohydrate chemistry and drug discovery. However, further studies are needed to fully understand the mechanism of action of ATAGI and to evaluate its long-term toxicity and safety. In addition, the development of new analytical methods and derivatives of ATAGI can further expand its potential applications in various fields of research and industry.
| CAS Number | 20590-45-8 |
| Product Name | 2-Acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranosyl isothiocyanate |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate |
| Molecular Formula | C15H20N2O8S |
| Molecular Weight | 388.39 g/mol |
| InChI | InChI=1S/C15H20N2O8S/c1-7(18)17-12-14(24-10(4)21)13(23-9(3)20)11(5-22-8(2)19)25-15(12)16-6-26/h11-15H,5H2,1-4H3,(H,17,18)/t11-,12-,13-,14-,15-/m1/s1 |
| InChI Key | PNMDNJALVHCMOX-KJWHEZOQSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1N=C=S)COC(=O)C)OC(=O)C)OC(=O)C |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1N=C=S)COC(=O)C)OC(=O)C)OC(=O)C |
| Isomeric SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1N=C=S)COC(=O)C)OC(=O)C)OC(=O)C |
CAS No: 20590-45-8MDL No: MFCD09750689 Chemical Formula: C15H20N2O8S Molecular Weight: 388.39 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
10 in stock
Catalog No: G01534TU
Molecular Formula: C₄₀H₆₈N₂O₃₁
Molecular Weight: 1072.96 g/mol
Structure (IUPAC): Gal(β1-3)GlcNAc(β1-3)Gal(β1-3)GlcNAc(β1-3)Gal(β1-4)Glc
Packaging: Available in research quantities
10 in stock
GalNAc-a1,3-(Fuc-a1,2)-Gal-b1,4-Glc, CAS:59957-92-5, G19524AS
10 in stock
10 in stock
Not a member? Create an account
Already got an account? Sign in here