2-Chloro-4-nitrophenyl b-D-lactoside
2-Chloro-4-nitrophenyl b-D-galactopyranoside is a chromogenic enzyme substrate used to study the activity of beta-lactoside. It produces a yellow color when cleaved by the enzyme, making it a useful tool in enzyme assays and screening experiments.
Highly sensitive lactosidase, yellow coloured probe that releases the product 2-chloro-4-nitrophenol (CNP). Can be monitored spectrophotometrically at 405 nm. The rate of formation of 2-chloro-4-nitrophenol is directly proportional to the lactosidase activity in the sample. The pKa of CNP is approximately 5.5.
| CAS Number | 120583-41-7 |
| Product Name | 2-Chloro-4-nitrophenyl-beta-D-lactoside |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-6-(2-chloro-4-nitrophenoxy)-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C18H24ClNO13 |
| Molecular Weight | 497.83 g/mol |
| InChI | InChI=1S/C18H24ClNO13/c19-7-3-6(20(28)29)1-2-8(7)30-17-15(27)13(25)16(10(5-22)32-17)33-18-14(26)12(24)11(23)9(4-21)31-18/h1-3,9-18,21-27H,4-5H2/t9-,10-,11+,12+,13-,14-,15-,16-,17-,18+/m1/s1 |
| InChI Key | RFGBZYLCQCJGOG-MUKCROHVSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| Canonical SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| Isomeric SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)O |
| CAS No: 120583-41-7 Synonyms: Gal-b-1,4-Glc-b-CNP MDL No: MFCD00037473 Chemical Formula: C18H24ClNO13 Molecular Weight: 497.83 |
| References: 1. Nidetzky B, Steiner W, Hayn M, Claeyssens M,, J. Biochem., 1994, p298 |