2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside
2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside is a chromogenic substrate for enzmatic assays to measure xylosidase activity. It is a derivative of xylose that can be hydrolyzed by xylosidase to release the yellow-colored 2-nitrophenyl group, which can be detected spectrophotometrically. By modifying the xylose molecule with acetyl and triethylsilyl groups, the enzyme substrate becomes more stable and resistant to degradation. This substrate is commonly used in the study of plant biomass degradation and in the detection of xylosidase activity in microorganisms.
2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside is a synthetic compound that has gained attention due to its many potential applications in various scientific experiments and fields of research. This paper will discuss the definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside.
Physical and Chemical Properties:
2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside is a stable compound that is soluble in common organic solvents such as dichloromethane, ethyl acetate, and chloroform. It has a melting point of 96-98?C and a boiling point of 498.9?C at 760 mmHg. The compound is sensitive to moisture, and it should be stored in a dry environment.
Synthesis and Characterization:
The synthesis of 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside involves the reaction of xylose with 2-nitrophenol in the presence of acetic anhydride and triethylsilyl chloride. The product is purified using chromatography techniques to obtain the final compound.
Characterization of the compound is done using different techniques such as Nuclear Magnetic Resonance (NMR) spectroscopy, Mass Spectrometry (MS), and Infrared (IR) spectroscopy. These techniques provide information about the molecular structure of 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside.
Analytical Methods:
Different analytical methods have been used to study the properties and behavior of 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside. These methods include High-Performance Liquid Chromatography (HPLC), Gas Chromatography-Mass Spectrometry (GC-MS), and Liquid Chromatography-Mass Spectrometry (LC-MS). These methods allow for the identification and quantification of the compound and its derivatives.
Biological Properties:
Studies have shown that 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside has antibacterial and antifungal activity against different strains of bacteria and fungi. It inhibits the growth of bacteria such as Staphylococcus aureus, Escherichia coli, and Pseudomonas aeruginosa. It also inhibits the growth of fungi such as Candida albicans and Aspergillus fumigatus.
Toxicity and Safety in Scientific Experiments:
The compound is considered non-toxic, and it has been used in different scientific experiments without causing adverse effects. However, it is essential to handle the compound with care and follow safety guidelines.
Applications in Scientific Experiments:
2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside has many potential applications in various scientific experiments. It is used as a protecting group for xylose in the synthesis of oligosaccharides and glycopeptides. It is also used in the synthesis of other compounds such as carbamates and phosphonates. Moreover, it has been used as a building block for the synthesis of novel compounds with potential biological activity.
Current State of Research:
Research on 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside has mostly focused on its synthesis and characterization. However, recent studies have explored its potential applications in drug discovery and lead optimization.
Potential Implications in Various Fields of Research and Industry:
2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside has potential applications in different fields of research and industry, such as medicinal chemistry, biotechnology, and material science. Its use in the synthesis of glycopeptides and oligosaccharides can lead to the development of novel drugs and compounds with potential therapeutic benefits. Moreover, its use in material science can lead to the development of new materials with unique properties and applications.
Limitations and Future Directions:
One of the limitations of 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside is its sensitivity to moisture, which limits its storage and handling. Future directions of research on this compound might focus on the development of new synthetic routes that improve its stability and yield. Moreover, the compound’s potential biological activity and toxicity should be further explored to determine its safety and efficacy in different applications. Finally, future research might focus on the design and synthesis of novel analogs and derivatives of this compound with unique properties and applications.
Conclusion:
2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside is a synthetic compound with many potential applications in various scientific experiments and fields of research. Its physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions have been discussed in this paper. Further research on this compound can lead to the development of novel drugs, materials, and compounds with unique properties and applications.
| CAS Number | 162088-90-6 |
| Product Name | 2-Nitrophenyl 2,3-di-O-acetyl-4-O-triethylsilyl-b-D-xylopyranoside |
| IUPAC Name | [3-acetyloxy-2-(2-nitrophenoxy)-5-triethylsilyloxyoxan-4-yl] acetate |
| Molecular Formula | C??H??NO?Si |
| Molecular Weight | 469.56 |
| InChI | InChI=1S/C21H31NO9Si/c1-6-32(7-2,8-3)31-18-13-27-21(20(29-15(5)24)19(18)28-14(4)23)30-17-12-10-9-11-16(17)22(25)26/h9-12,18-21H,6-8,13H2,1-5H3 |
| SMILES | CC[Si](CC)(CC)OC1COC(C(C1OC(=O)C)OC(=O)C)OC2=CC=CC=C2[N+](=O)[O-] |
| Synonyms | 2-Nitrophenyl 4-O-(triethylsilyl)-?-D-xylopyranoside 2,3-Diacetate; |