5-Cyclohexylpentyl-4-O-(a-D-glucopyranosyl)-b-D-glucopyranoside
5-Cyclohexylpentyl-b-D-maltoside,
The glycosylation process is a chemical reaction in which an organic molecule is attached to a sugar or other carbohydrate. The product of this process is known as a glycoside. Glycosylations are important in the synthesis of complex carbohydrates and glycoconjugates. The most common glycosidic bond that is formed is between the hydroxyl group of a saccharide (such as glucose) and the amino group of another saccharide (such as N-acetylglucosamine). The most common type of glycosylation reaction is the formation of an O-glycosidic bond between two sugars, such as glucose and N-acetylgalactosamine, to form the disaccharide lactose. There are many different types of glycosylations, including methylation, Click modification, fluorination, saccharide modification, and custom synthesis.
CAS Number |
250692-65-0 |
Product Name |
5-Cyclohexyl-1-pentyl-beta-D-maltoside |
IUPAC Name |
(2R,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6R)-6-(5-cyclohexylpentoxy)-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
Molecular Formula |
C23H42O11 |
Molecular Weight |
494.57 g/mol |
InChI |
InChI=1S/C23H42O11/c24-11-14-16(26)17(27)19(29)23(32-14)34-21-15(12-25)33-22(20(30)18(21)28)31-10-6-2-5-9-13-7-3-1-4-8-13/h13-30H,1-12H2/t14-,15-,16-,17+,18-,19-,20-,21-,22-,23-/m1/s1 |
InChI Key |
RVTGFZGNOSKUDA-ZNGNCRBCSA-N |
SMILES |
C1CCC(CC1)CCCCCOC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
Solubility |
Soluble in DMSO |
Synonyms |
cyclohexyl-pentyl-beta-D-maltoside, cyclohexyl-pentyl-maltoside, CYMAL-5 |
Canonical SMILES |
C1CCC(CC1)CCCCCOC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
Isomeric SMILES |
C1CCC(CC1)CCCCCO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |