3-Amino-3-deoxy-1, 2:5, 6-di-O-isopropylidene-a-D-glucofuranose, CAS:24384-84-7

Request a quote

Catalog No: A10GD-5100

24384-84-7 ,3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose,

CAS:24384-84-7

C12H21NO5 / 259.3

MFCD09750692

+

  Share
Guaranteed Safe CheckoutTrust

3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose is a chemical compound that belongs to the amino sugar group. It is often utilized in the fields of medicinal chemistry, biochemistry, and pharmacology. In this paper, we will discuss the various physical and chemical properties, the synthesis and characterization processes, diverse analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions concerning 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose.

Definition and Background:

3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose is a monosaccharide consisting of five carbon atoms. It is a derivative of glucose, a sugar that is commonly found in many food products such as fruits, vegetables, and honey. This amino sugar is characterized by the presence of an amine group (-NH2) and a carboxyl group (-COOH). Studies have shown that 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose has potential benefits in the field of drug development, due to its ability to inhibit specific enzymes that play a role in certain diseases.

Synthesis and Characterization:

3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose can be synthesized through several methods, including the reaction of glucose with hydroxylamine in the presence of acetic anhydride and hydrogen chloride. The product is then purified using several techniques such as recrystallization and chromatography. The characterization of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose is typically done using techniques such as nuclear magnetic resonance (NMR) spectroscopy, infrared spectroscopy, and mass spectrometry.

Analytical Methods:

When analyzing 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose, several analytical methods can be used, including high-performance liquid chromatography (HPLC), gas chromatography (GC), and capillary electrophoresis (CE). These methods are useful in quantifying the amount of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose present in a sample and determining its purity.

Biological Properties:

Studies have found that 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose has several biological properties, including its ability to inhibit specific enzymes in certain diseases. For example, it has been shown to inhibit the growth of specific cancer cells and prevent the replication of certain viruses.

Toxicity and Safety in Scientific Experiments:

The toxicity and safety of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose in scientific experiments are yet to be fully understood. However, studies have shown that it can cause irritation to the respiratory system, skin, and eyes. It is important to wear protective gear when handling this chemical compound and follow proper laboratory safety procedures.

Applications in Scientific Experiments:

3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose has various applications in scientific experiments, including drug development, enzyme inhibitors, and the study of metabolic pathways.

Current State of Research:

Currently, research is ongoing on the potential medicinal properties of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose. The compound?s various biological activities are being explored, and efforts are being made to optimize its synthesis and improve its pharmacological properties.

Potential Implications in Various Fields of Research and Industry:

The potential implications of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose in various fields of research and industry are varied. In the pharmaceutical industry, it is being explored as a potential treatment for cancer and specific viruses. In the field of biochemistry and metabolism, it is being used in the study of metabolic pathways. The compound?s ability to inhibit specific enzymes makes it a promising tool in enzyme inhibitors.

Limitations and Future Directions:

One limitation of using 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose in scientific experiments and drug development is its cost and availability. Another limitation is the incomplete understanding of its toxicity and safety. Future research should focus on improving the synthesis process, understanding the compound?s safety profile and improving its pharmacological properties. The following are some potential future directions for research:

1. Investigating the medicinal properties of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose in other diseases.

2. Further exploration of the compound?s mechanism of action and metabolic pathways.

3. Evaluating the toxicity and safety of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose in preclinical and clinical studies.

4. Researching into improving the synthesis process and optimizing the compound?s pharmacological properties.

5. Identifying potential new applications of 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose in different industries and fields of research.

CAS Number 24384-84-7
Product Name 3-Amino-3-deoxy-1,2:5,6-di-O-isopropylidene-alpha-D-glucofuranose
IUPAC Name (3aS,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-amine
Molecular Formula C??H??NO?
Molecular Weight 259.3
InChI InChI=1S/C12H21NO5/c1-11(2)14-5-6(16-11)8-7(13)9-10(15-8)18-12(3,4)17-9/h6-10H,5,13H2,1-4H3/t6?,7?,8-,9?,10+/m1/s1
SMILES CC1(OCC(O1)C2C(C3C(O2)OC(O3)(C)C)N)C
Synonyms 3-Amino-3-deoxy-1,2:5,6-bis-O-(1-methylethylidene)-?-D-glucofuranose
CAS No: 24384-84-7 MDL No: MFCD09750692 Chemical Formula: C12H21NO5 Molecular Weight: 259.3

2. MSDS

3. Tech Data Sheets/Manuals

Size

1 G, 100 MG, 5 G, Other

YOU MAY ALSO LIKE…
My Cart
Close Wishlist
Close Recently Viewed
Categories