3-Carboxyumbelliferyl b-D-galactopyranoside , CUG;
Carboxyumbelliferyl b-D-galactoside
3-Carboxyumbelliferyl b-D-galactopyranoside is a fluorescent probe that can be used to study protein synthesis in live cells. It binds to the active site of the enzyme peptidyl transferase, which catalyzes the covalent linkage of amino acids to form a polypeptide chain. 3CMBG is specific for the amino acid proline and is a substrate for peptidyl transferase. The fluorescence of 3CMBG increases when it is bound to peptidyl transferase, making it useful as a marker for protein synthesis.
CUG (3-Carboxyumbelliferyl-?-D-galactopyranoside) is a fluorogenic substrate (?ex=386, ?em=445 nm, ?=32K).
| CAS Number | 64664-99-9 |
| Product Name | 3-Carboxyumbelliferyl beta-D-galactopyranoside |
| IUPAC Name | 2-oxo-7-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromene-3-carboxylic acid |
| Molecular Formula | C??H??O?? |
| Molecular Weight | 368.29 g/mol |
| InChI | InChI=1S/C16H16O10/c17-5-10-11(18)12(19)13(20)16(26-10)24-7-2-1-6-3-8(14(21)22)15(23)25-9(6)4-7/h1-4,10-13,16-20H,5H2,(H,21,22)/t10-,11+,12+,13-,16-/m1/s1 |
| InChI Key | HGMXXIAQZWTZLR-WUGLTUCPSA-N |
| SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C(=C2)C(=O)O |
| Canonical SMILES | C1=CC2=C(C=C1OC3C(C(C(C(O3)CO)O)O)O)OC(=O)C(=C2)C(=O)O |
| Isomeric SMILES | C1=CC2=C(C=C1O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)OC(=O)C(=C2)C(=O)O |