4-Aminophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
4-Aminophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a monosaccharide that belongs to the group of complex carbohydrates. It is a synthetic compound that has been modified by fluorination and methylation. 4-Aminophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside has been used in the synthesis of polysaccharides and saccharides for various purposes, including as a fluorescence probe for carbohydrate binding proteins. It has also been used as an intermediate in the synthesis of oligosaccharides or polysaccharides.
| CAS Number | 14419-59-1 |
| Product Name | 4-Aminophenyl 2-acetamido-2-deoxy-b-D-glucopyranoside |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2-(4-aminophenoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| Molecular Formula | C??H??N?O? |
| Molecular Weight | 312.32 |
| InChI | InChI=1S/C14H20N2O6/c1-7(18)16-11-13(20)12(19)10(6-17)22-14(11)21-9-4-2-8(15)3-5-9/h2-5,10-14,17,19-20H,6,15H2,1H3,(H,16,18)/t10-,11-,12-,13-,14-/m1/s1 |
| SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=C(C=C2)N)CO)O)O |
| Synonyms | 4-Aminophenyl 2-(Acetylamino)-2-deoxy-?-D-glucopyranoside; p-Aminophenyl 2-Acetamido-2-deoxy-?-D-glucopyranoside; p-Aminophenyl-N-acetyl-?-D-glucosaminide; |
CAS No: 14419-59-1
Synonyms: 4-Aminophenyl 2-(acetylamino)-2-deoxy-?-D-glucopyranoside MDL No: MFCD00056073
Chemical Formula: C14H20N2O6
Molecular Weight: 312.32 |