4-Methylumbelliferyl b-D-mannopyranoside
4-Methylumbelliferyl b-D-mannopyranoside is a fluorescent probe that can be used to measure the activity of the enzyme ?-glycosidase. It is synthesized from 4-methylumbelliferone, which reacts with b-D-mannopyranosyl chloride and pyridine, followed by glycosylation with glucal. The maximum absorption of this compound occurs at a wavelength of 400 nm in an acidic solution. The pH optimum for this compound is 5.5, so it should not be used in tissues or organs where the pH is greater than 7.4. This product has been found to have no adverse effects on animals and does not react with other enzymes, making it suitable for use as a biochemical marker for liver cells or tissues.
| CAS Number | 67909-30-2 |
| Product Name | 4-Methylumbelliferyl beta-D-mannopyranoside |
| IUPAC Name | 4-methyl-7-[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| Molecular Formula | C16H18O8 |
| Molecular Weight | 338.31 g/mol |
| InChI | InChI=1S/C16H18O8/c1-7-4-12(18)23-10-5-8(2-3-9(7)10)22-16-15(21)14(20)13(19)11(6-17)24-16/h2-5,11,13-17,19-21H,6H2,1H3/t11-,13-,14+,15+,16-/m1/s1 |
| InChI Key | YUDPTGPSBJVHCN-NZBFACKJSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O |
| Synonyms | 7-(?-D-mannopyranosyloxy)-4-methyl-2H-1-benzopyran-2-one; 4-Methylumbelliferyl-?-D-mannoside; |
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)OC3C(C(C(C(O3)CO)O)O)O |
| Isomeric SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)O[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
CAS No: 67909-30-2 Synonyms: 4-MU-b-D-Man MDL No: MFCD00069855 Chemical Formula: C16H18O8 Molecular Weight: 338.31
|