4-Methylumbelliferyl lignocerate
4-Methylumbelliferyl tetracosanate,
4-Methylumbelliferyl lignocerate is a synthetic fatty acid that inhibits the growth of cancer cells. It has been shown to have an inhibitory effect on breast cancer cell lines, such as MDA-MB-231 and MCF-7. This compound also inhibits the production of estrogen by binding to the human estrogen receptor (ER) ?, which leads to a decrease in cellular proliferation. Another study found that 4-methylumbelliferyl lignocerate conjugates with tamoxifen and inhibits estrogen synthesis in breast cancer cells.
CAS Number |
84434-52-6 |
Product Name |
4-Methyl-2-oxo-2H-1-benzopyran-7-yl tetracosanoate |
IUPAC Name |
(4-methyl-2-oxochromen-7-yl) tetracosanoate |
Molecular Formula |
C34H54O4 |
Molecular Weight |
526.8 g/mol |
InChI |
InChI=1S/C34H54O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-33(35)37-30-25-26-31-29(2)27-34(36)38-32(31)28-30/h25-28H,3-24H2,1-2H3 |
InChI Key |
BBJLPGKQHTUSCG-UHFFFAOYSA-N |
SMILES |
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC1=CC2=C(C=C1)C(=CC(=O)O2)C |
Canonical SMILES |
CCCCCCCCCCCCCCCCCCCCCCCC(=O)OC1=CC2=C(C=C1)C(=CC(=O)O2)C |