5-Bromo-3-indolyl decanoate
Blue caprate; 5-Bromo-3-indolyl caprylate
5-Bromo-3-indolyl decanoate (BID) is a chromogenic enzyme substrate often used for the detection of lipase activity. It is hydrolyzed by lipase to produce a blue-violet product, which can be detected visually or by spectrophotometry. BID is particularly useful for the detection of microbial lipases in food and environmental samples. It is commonly used in a wide range of biochemical, biological, and environmental testing applications that require precise lipase enzyme analysis.
| CAS Number | 133950-71-7 |
| Product Name | 5-Bromo-1H-indol-3-yl decanoate |
| IUPAC Name | (5-bromo-1H-indol-3-yl) decanoate |
| Molecular Formula | C18H24BrNO2 |
| Molecular Weight | 366.3 g/mol |
| InChI | InChI=1S/C18H24BrNO2/c1-2-3-4-5-6-7-8-9-18(21)22-17-13-20-16-11-10-14(19)12-15(16)17/h10-13,20H,2-9H2,1H3 |
| InChI Key | MSQDUIOYSURQKS-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCC(=O)OC1=CNC2=C1C=C(C=C2)Br |
| Canonical SMILES | CCCCCCCCCC(=O)OC1=CNC2=C1C=C(C=C2)Br |