6-Amino-6-deoxyluciferin, ADL
6-Amino-6-deoxyluciferin is a synthetic analog of luciferin. It is used as a substrate for bacterial luciferase and in immunoassays to detect neutrophils, infectious diseases, and various protease activities. 6-Amino-6-deoxyluciferin is synthesized by the condensation of an amide with a hydroxyl group from acetaldehyde. This reaction requires the use of a coupling agent such as dicyclohexylcarbodiimide or 1-(3-dimethylaminopropyl)-3-ethylcarbodiimide hydrochloride (EDC), which are often used to form amides from carboxylic acids and amines. The conjugation of 6-amino-6-deoxyluciferin with antibodies can be accomplished by chemical crosslinking methods, such as glutaraldehyde, which react thiol groups on the antibody
CAS Number | 118969-27-0 |
Product Name | 2-(6-Amino-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
IUPAC Name | 2-(6-amino-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
Molecular Formula | C11H9N3O2S2 |
Molecular Weight | 279.3 g/mol |
InChI | InChI=1S/C11H9N3O2S2/c12-5-1-2-6-8(3-5)18-10(13-6)9-14-7(4-17-9)11(15)16/h1-3,7H,4,12H2,(H,15,16) |
InChI Key | HKSJKXOOBAVPKR-UHFFFAOYSA-N |
SMILES | C1C(N=C(S1)C2=NC3=C(S2)C=C(C=C3)N)C(=O)O |
Canonical SMILES | C1C(N=C(S1)C2=NC3=C(S2)C=C(C=C3)N)C(=O)O |