6-Chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside
6-Chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a pink enzyme substrate commonly used in biochemical research and diagnostic applications. This compound is a derivative of indolyl glucopyranoside, which is known for its ability to produce a colored product upon enzymatic hydrolysis. 6-Chloro-3-indolyl 2-acetamido-2-deoxy-b-D-glucopyranoside is particularly useful for studying glycosidases, enzymes that cleave glycosidic bonds in complex carbohydrates. Its pink coloration makes it an ideal choice for colorimetric assays, enabling researchers to monitor enzyme activity in real-time and facilitating the development of new diagnostic tools and therapeutic strategies.
CAS Number |
156117-44-1 |
Product Name |
6-Chloro-3-indolyl N-acetyl-beta-D-glucosaminide |
IUPAC Name |
N-[(2S,3R,4R,5S,6R)-2-[(6-chloro-1H-indol-3-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
Molecular Formula |
C16H19ClN2O6 |
Molecular Weight |
370.78 g/mol |
InChI |
InChI=1S/C16H19ClN2O6/c1-7(21)19-13-15(23)14(22)12(6-20)25-16(13)24-11-5-18-10-4-8(17)2-3-9(10)11/h2-5,12-16,18,20,22-23H,6H2,1H3,(H,19,21)/t12-,13-,14-,15-,16-/m1/s1 |
InChI Key |
BPAUSWAPDXGBCS-OXGONZEZSA-N |
SMILES |
CC(=O)NC1C(C(C(OC1OC2=CNC3=C2C=CC(=C3)Cl)CO)O)O |
Canonical SMILES |
CC(=O)NC1C(C(C(OC1OC2=CNC3=C2C=CC(=C3)Cl)CO)O)O |
Isomeric SMILES |
CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=CNC3=C2C=CC(=C3)Cl)CO)O)O |
CAS No: 156117-44-1
Synonyms: 6-Chloro-3-indolyl N-acetyl-b-D-glucosaminideSalmon-b-D-GlcNAc6-Chloro-3-(2-acetamido-2-deoxy-b-D-glucopyranosyloxy)indole
MDL No: MFCD04972051
Chemical Formula: C16H19ClN2O6
Molecular Weight: 370.78 |