6-Chloro-3-indoxyl-3-acetate
6-Chloro-3-indoxyl-3-acetate is a fluorogenic substrate used in food testing and environmental testing. It is also a chromogenic substrate that can be conjugated to an enzyme or ligand for use in diagnostics. 6-Chloro-3-indoxyl-3-acetate has high purity and quality, and is CAS No. 114305-99-6. It reacts with hydrogen peroxide to form 6-(chloromethyl) indole, which generates light when oxidized by the horseradish peroxidase enzyme. This reaction is called chemiluminescence or bioluminescence, depending on the type of reaction being catalyzed by the horseradish peroxidase enzyme.
CAS Number |
114305-99-6 |
Product Name |
6-chloro-1H-indol-3-yl acetate |
IUPAC Name |
(6-chloro-1H-indol-3-yl) acetate |
Molecular Formula |
C10H8ClNO2 |
Molecular Weight |
209.63 g/mol |
InChI |
InChI=1S/C10H8ClNO2/c1-6(13)14-10-5-12-9-4-7(11)2-3-8(9)10/h2-5,12H,1H3 |
InChI Key |
IPTGFPYPSDDUBV-UHFFFAOYSA-N |
SMILES |
CC(=O)OC1=CNC2=C1C=CC(=C2)Cl |
Canonical SMILES |
CC(=O)OC1=CNC2=C1C=CC(=C2)Cl |