6-Chloro-3-indolyl butyrate , Salmon-butyrate
6-Chloro-3-indolyl butyrate is an enzyme substrate that is used in a variety of applications, including environmental testing and diagnostics. 6CIBA is a fluorogenic substrate that can be used to detect the presence of peroxidase or other oxidizing enzymes in a variety of different samples, such as culture media, food testing, and diagnostics. 6CIBA reacts with hydrogen peroxide or other oxidant to produce 6-chloro-3-indolyl acetic acid (6CIAA), which has a high extinction coefficient at 350 nm and can be detected using a fluorescence spectrophotometer.
CAS Number | 159954-34-4 |
Product Name | 6-Chloro-3-indoxyl butyrate |
IUPAC Name | (6-chloro-1H-indol-3-yl) butanoate |
Molecular Formula | C12H12ClNO2 |
Molecular Weight | 237.68 g/mol |
InChI | InChI=1S/C12H12ClNO2/c1-2-3-12(15)16-11-7-14-10-6-8(13)4-5-9(10)11/h4-7,14H,2-3H2,1H3 |
InChI Key | GOEDSAJOXJKQKC-UHFFFAOYSA-N |
SMILES | CCCC(=O)OC1=CNC2=C1C=CC(=C2)Cl |
Canonical SMILES | CCCC(=O)OC1=CNC2=C1C=CC(=C2)Cl |