6-Chloro-1H-indol-3-yl octanoate
6-Chloro-1H-indol-3-yl octanoate is a fluorogenic substrate that can be used to detect enzymes such as phosphatases, lipases, esterases, and proteases. 6-Chloro-1H-indol-3-yl octanoate is a ligand for metal ions such as Cu(II), Ni(II) and Zn(II). This product has high purity and quality. It is an enzyme substrate for many enzymes such as phosphatases, lipases, esterases, and proteases. This product can be used in diagnostics of various substances including food testing, environmental testing and staining. 6CIO is a chromogenic substrate that can be used to detect bioluminescence reactions.
CAS Number |
159954-35-5 |
Product Name |
6-Chloro-3-indoxyl caprylate |
IUPAC Name |
(6-chloro-1H-indol-3-yl) octanoate |
Molecular Formula |
C16H20ClNO2 |
Molecular Weight |
293.79 g/mol |
InChI |
InChI=1S/C16H20ClNO2/c1-2-3-4-5-6-7-16(19)20-15-11-18-14-10-12(17)8-9-13(14)15/h8-11,18H,2-7H2,1H3 |
InChI Key |
KBOGGXOQZZEFSL-UHFFFAOYSA-N |
SMILES |
CCCCCCCC(=O)OC1=CNC2=C1C=CC(=C2)Cl |
Canonical SMILES |
CCCCCCCC(=O)OC1=CNC2=C1C=CC(=C2)Cl |