6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose is a chemical compound with a complex structure and unique properties that have sparked scientific interest in its potential applications in various fields of research and industry. This paper will provide an in-depth analysis of the chemical compound, discussing its definition and background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Definition and Background
6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose is a compound that belongs to the class of iodo-sugars. It is synthesized from galactose, which is a monosaccharide with six carbons. The compound is a derivative of galactose and has a unique structure due to the presence of a di-O-isopropylidene that creates a cyclic structure. The chemical compound has a molecular formula of C12H19IO5 and a molecular weight of 370.18 g/mol.
Physical and Chemical Properties
6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose is a white solid with a melting point range of 134-136 ?C. The compound is soluble in polar organic solvents such as methanol, ethanol, and acetone but insoluble in water. It is stable at room temperature and undergoes decomposition at a high temperature. The molecular structure of the compound is characterized by the presence of an iodine atom, which gives it unique physical and chemical properties. The iodo-sugar is a good source of iodine for biological systems.
Synthesis and Characterization
6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose is synthesized from galactose through a multi-step reaction process that involves protection and deprotection of hydroxyl groups. The synthesis process involves the reaction of galactose with trimethylsilyl iodide, which forms the trimethylsilyl ether derivative. The trimethylsilyl derivative undergoes another reaction with a di-isopropylidene protecting group to form 1,2-di-O-isopropylidene-3,4-di-O-trimethylsilyl galactose. The final step of the synthesis involves the selective removal of the trimethylsilyl and isopropylidene protecting groups to form 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose.
Analytical Methods
The analysis of 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose involves the use of various analytical techniques such as NMR spectroscopy, IR spectroscopy, mass spectrometry, and X-ray diffraction. NMR spectroscopy is used to determine the chemical structure and purity of the compound. IR spectroscopy provides information on the functional groups present in the compound. Mass spectrometry is used to determine the molecular weight and purity of the compound. X-ray diffraction is used to determine the crystal structure of the compound.
Biological Properties
6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose has been shown to exhibit antimicrobial and anticancer properties. The compound has been found to be effective against Gram-positive bacteria, including methicillin-resistant Staphylococcus aureus. It has also been found to inhibit the growth of human breast cancer cells. The antimicrobial and anticancer properties of the compound make it a potential candidate for the development of new drugs.
Toxicity and Safety in Scientific Experiments
The toxicity and safety of 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose in scientific experiments have not been extensively studied. However, the compound is known to be toxic at high concentrations. It is recommended to handle the compound with care and to follow safety guidelines when conducting experiments with it.
Applications in Scientific Experiments
6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose has several applications in scientific experiments. It can be used as a precursor for the synthesis of other iodo-sugars. The compound can also be used as a tool for the development of new drugs due to its antimicrobial and anticancer properties. Furthermore, the compound can be used as a chiral building block in organic synthesis.
Current State of Research
The current state of research on 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose is focused on its applications in drug development and organic synthesis. There is ongoing research on the biological properties of the compound and its potential use as an antimicrobial and anticancer agent. Furthermore, research is being conducted on the synthesis of other iodo-sugars using 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose as a precursor.
Potential Implications in Various Fields of Research and Industry
The potential implications of 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose in various fields of research and industry are significant. The compound has potential applications in drug development, organic synthesis, and the food industry. Its antimicrobial and anticancer properties make it a potential candidate for the development of new drugs. The compound can also be used as a chiral building block in organic synthesis. In the food industry, the compound can be used as a sweetener due to its unique sugar structure.
Limitations and Future Directions
One of the limitations of 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-?-D-galactopyranose is its toxicity at high concentrations. Further research is needed to determine the toxicity and safety of the compound in scientific experiments. Future directions for research on the compound include exploring its potential applications in other fields of research and industry. The compound has unique physical and chemical properties that may have implications in fields such as materials science and nanotechnology. Furthermore, research is needed to explore the potential of the compound as a sweetener in the food industry.
| CAS Number | 4026-28-2 |
| Product Name | 6-Deoxy-1,2:3,4-di-O-isopropylidene-6-iodo-ALPHA-D-galactopyranose |
| IUPAC Name | 8-(iodomethyl)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| Molecular Formula | C12H19IO5 |
| Molecular Weight | 370.18 g/mol |
| InChI | InChI=1S/C12H19IO5/c1-11(2)15-7-6(5-13)14-10-9(8(7)16-11)17-12(3,4)18-10/h6-10H,5H2,1-4H3 |
| InChI Key | JMIGDGVTFPSEMQ-UHFFFAOYSA-N |
| SMILES | CC1(OC2C(OC3C(C2O1)OC(O3)(C)C)CI)C |
| Canonical SMILES | CC1(OC2C(OC3C(C2O1)OC(O3)(C)C)CI)C |
| CAS No: 4026-28-2 MDL No: MFCD00038408 Chemical Formula: C12H19IO5 Molecular Weight: 370.18 |