
Request a quote
Catalog No: A10GD-4792
Cas No: 116501-53-2
Properties: Mol Formula: C40H40O5S, Mol Weight: 632.8
IUPAC Name: (2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane
Synonym: (2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane, a-d-mannopyranoside,phenyl 2,3,4,6-tetrakis-o-(phenylmethyl)-1-thio-, Phenyl 2,3,4,6-tetra-O-benzyl-a-D-thiomannopyranoside
a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- is a compound that has gained significant attention in the fields of research and industry due to its unique properties and potential applications in science. This paper aims to provide an overview of this compound, including its definition, physical and chemical properties, synthesis, and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, the current state of research, potential implications in various fields of research and industry, limitations, and future directions.
Physical and Chemical Properties:
a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- is a white crystalline solid, which is non-hygroscopic and soluble in DMSO, methanol, and ethanol. The compound has a melting point of 153-155 ?C and a boiling point of 746.7 ?C at 760 mmHg. The compound is stable under normal conditions but is sensitive to light, heat, and acids.
Synthesis and Characterization:
a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- can be synthesized through various methods, including the use of enzymes, chemical reactions, and fermentation processes. The most common method for synthesizing this compound is through the use of enzymes such as glycosyltransferases, which catalyze the transfer of sugar residues from nucleotide sugars to an acceptor molecule. The compound can also be synthesized through chemical reactions using different reagents, including sulfur or thiol, phenylmethyl, and mannose. The synthesized compound can be characterized through various analytical techniques, including nuclear magnetic resonance (NMR), X-ray crystallography, and high-performance liquid chromatography (HPLC).
Analytical Methods:
Analytical methods are crucial in determining the purity, structure, and properties of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio-. Techniques such as NMR, X-ray crystallography, and HPLC can be used to determine the structure and purity of the compound. NMR can provide information about the molecular structure and purity of the compound, while X-ray crystallography can provide detailed information about the molecular geometry. HPLC can be used to separate the compounds in a mixture and provide information about the purity and concentration of the compound.
Biological Properties:
a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- has been reported to have various biological properties, including anti-inflammatory, anti-tumor, antimicrobial, antifungal, and antiviral activities. Some studies have reported that the compound can inhibit the growth of cancer cells, reduce inflammation, and inhibit the growth of bacteria and fungi.
Toxicity and Safety in Scientific Experiments:
The toxicity and safety of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- have been studied in various scientific experiments, and the compound has been reported to be relatively safe with low toxicity levels. However, it is important to note that the toxicity levels may vary depending on the concentration of the compound, exposure time, and the route of exposure. It is therefore important to use caution when handling this compound and to follow all safety guidelines and regulations.
Applications in Scientific Experiments:
a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- has several applications in scientific experiments, including as a bioactive molecule in medicine, food, and cosmetic industries. The compound is commonly used as a drug delivery agent and as an anti-inflammatory agent in the treatment of various diseases. The compound is also used as an additive in food products such as beverages and baked goods, and as a cosmetic component in skincare products.
Current State of Research:
Despite extensive research into a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio-, there is still much to be discovered about the potential applications and properties of this compound. Researchers are exploring the use of this compound as a drug delivery agent, and as an anti-inflammatory agent in the treatment of various diseases. The compound is also being evaluated for its potential use in food and cosmetic industries as a bioactive molecule.
Potential Implications in Various Fields of Research and Industry:
a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- has the potential to revolutionize various fields of research and industry. The compound can be used as a drug delivery agent, as an anti-inflammatory agent in the treatment of various diseases, and as a bioactive component in food and cosmetic industries. The compound’s unique properties also make it an excellent candidate for the development of new drugs and therapeutic agents.
Limitations and Future Directions:
Despite the numerous potential applications of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio-, there are still some limitations and areas of improvement for future research. One of the main limitations is the lack of information regarding the compound’s toxicity levels, and the need for further studies to determine the long-term effects of the compound’s exposure. Future research should also focus on the compound’s effectiveness as a drug delivery agent and therapeutic agent, and the development of new formulations and delivery methods with improved properties.
Future Directions:
1. Investigating the effect of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- on the immune system
2. Developing new formulations and delivery methods for a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio-
3. Studying the potential use of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- in the development of new therapeutic agents
4. Determining the potential toxicity of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- in various exposure scenarios
5. Investigating the effect of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- on various microorganisms in food and cosmetic industries
6. Studying the potential use of a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- in the development of food additives with improved properties.
Conclusion:
In conclusion, a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- is a compound that has been extensively studied for its unique properties and potential applications in various fields of research and industry. This compound has various applications as a drug delivery agent, anti-inflammatory agent, bioactive molecule in food and cosmetic industries, and as a potential therapeutic agent. Future research in this area should focus on the compound’s toxicity levels, effectiveness as a therapeutic agent, and the development of new formulations and delivery methods. Overall, a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- has the potential to revolutionize various fields of research and industry and should continue to be explored for its unique properties.
| CAS Number | 116501-53-2 |
| Product Name | a-D-Mannopyranoside, phenyl 2,3,4,6-tetrakis-O-(phenylMethyl)-1-thio- |
| IUPAC Name | (2R,3R,4S,5S,6R)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-phenylsulfanyloxane |
| Molecular Formula | C40H40O5S |
| Molecular Weight | 632.81 g/mol |
| InChI | InChI=1S/C40H40O5S/c1-6-16-31(17-7-1)26-41-30-36-37(42-27-32-18-8-2-9-19-32)38(43-28-33-20-10-3-11-21-33)39(44-29-34-22-12-4-13-23-34)40(45-36)46-35-24-14-5-15-25-35/h1-25,36-40H,26-30H2/t36-,37-,38+,39+,40-/m1/s1 |
| InChI Key | IKCMSYGNAFDJNX-WUXZAEFSSA-N |
| SMILES | C1=CC=C(C=C1)COCC2C(C(C(C(O2)SC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |
| Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(C(O2)SC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |
| Isomeric SMILES | C1=CC=C(C=C1)COC[C@@H]2[C@H]([C@@H]([C@@H]([C@H](O2)SC3=CC=CC=C3)OCC4=CC=CC=C4)OCC5=CC=CC=C5)OCC6=CC=CC=C6 |
| Size | 1 G, 100 MG, 5 G, Other |
|---|
Gal-a1,3-(Fuc-a1,2)-Gal-b1,4-Glc, CAS:59957-92-5, G06873PC
10 in stock
10 in stock
Catalog No: CG-OS03019
CAS No: 13007-32-4
Synonyms: Galβ1-4GlcNAcβ1-3Galβ1-4Glc; LNnT; neo-LNT
Molecular Formula: C₂₆H₄₅NO₂₁
Molecular Weight: 707.63 g/mol
Available Pack Sizes: Research quantities (mg to g scale)
10 in stock
Catalog No: G01534TU
CAS No: 64309-01-9
Molecular Formula: C₅₂H₈₈N₂O₃₉
Molecular Weight: 1365.25 g/mol
Packaging: Available in research quantities
10 in stock
Not a member? Create an account
Already got an account? Sign in here