Acetyl-L-alanine 7-amido-4-methylcoumarin
Acetyl-L-alanine 7-amido-4-methylcoumarin is a protease inhibitor that blocks the activity of peptidases, which are enzymes that break down proteins in the body. It inhibits the enzyme’s ability to cleave peptides into smaller units. Acetyl-L-alanine 7-amido-4-methylcoumarin binds to the active site of proteases and blocks the access of other substrate molecules, inhibiting proteolytic activity by steric hindrance. The enzyme’s conformational change prevents binding of other substrate molecules.
| CAS Number | 355137-87-0 | 
| Product Name | Acetyl-L-alanine 7-amido-4-methylcoumarin | 
| IUPAC Name | (2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)propanamide | 
| Molecular Formula | C15H16N2O4 | 
| Molecular Weight | 288.3 g/mol | 
| InChI | InChI=1S/C15H16N2O4/c1-8-6-14(19)21-13-7-11(4-5-12(8)13)17-15(20)9(2)16-10(3)18/h4-7,9H,1-3H3,(H,16,18)(H,17,20)/t9-/m0/s1 | 
| InChI Key | JOAJYKBVKPNJQC-VIFPVBQESA-N | 
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(C)NC(=O)C | 
| Synonyms | AC-ALA-AMC;Acetyl-L-alanine7-amido-4-methylcoumarin;355137-87-0;Ac-Ala-MCA;CTK8E7034;ZINC2392324;AKOS025295216;RT-011182;W-204221;(S)-2-acetamido-N-(4-methyl-2-oxo-2H-chromen-7-yl)propanamide | 
| Canonical SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)C(C)NC(=O)C | 
| Isomeric SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)NC(=O)C |