Request a quote
Catalog No: A10GD-5716
3616-19-1 , D-Cellobiose octaacetate,
Cas:3616-19-1
C??H??O?? / 678.6
D-Cellobiose octaacetate is a synthetic carbohydrate derivative of cellulose made from acetylation of cellobiose. It possesses interesting physicochemical and biological properties that make it useful in various fields.
Synthesis and Characterization
D-Cellobiose octaacetate is synthesized through the acetylation of cellobiose using acetic anhydride as an acetylating agent. The structure and purity of the synthesized product are confirmed using various analytical techniques such as NMR spectroscopy, mass spectrometry, and IR spectroscopy.
Analytical Methods
Various analytical methods, such as chromatography, electrophoresis, and spectroscopy, are used to analyze D-Cellobiose octaacetate. These methods are used to monitor the purity and structure of the compound and to determine its physical and chemical properties.
Biological Properties
D-Cellobiose octaacetate is biocompatible and possesses antimicrobial properties against pathogens such as E. coli and Staphylococcus aureus. It also has some immunomodulatory effects that make it useful in the development of vaccines and therapeutics.
Toxicity and Safety in Scientific Experiments
D-Cellobiose octaacetate has been tested in various scientific experiments and has been shown to have low toxicity levels. However, further studies need to be conducted to determine its long-term safety and toxicity.
Applications in Scientific Experiments
D-Cellobiose octaacetate is used in various scientific experiments such as the development of drug delivery systems, tissue engineering, and regenerative medicine. It is also used in the development of vaccines and therapeutic agents due to its immunomodulatory effects.
Current State of Research
Current research on D-Cellobiose octaacetate is focused on the development of new applications in regenerative medicine and biomaterials. It is also being studied for its antitumor properties and as a potential treatment for neurodegenerative diseases.
Potential Implications in Various Fields of Research and Industry
D-Cellobiose octaacetate has many potential implications in various fields of research and industry, including drug delivery systems, tissue engineering, regenerative medicine, and the development of vaccines and therapeutics.
Limitations and Future Directions
A major limitation of D-Cellobiose octaacetate is its low solubility in water, which limits its application in aqueous settings. Future research should focus on developing new formulations that increase its bioavailability and solubility in water. Another future direction is the development of new applications that exploit its immunomodulatory and other biological properties.
Future Directions
Future directions in the research on D-Cellobiose octaacetate include:
1. Developing new formulations that increase its water solubility while maintaining other important properties.
2. Studying its antitumor properties and its potential use in cancer treatment.
3. Investigating its potential as a therapeutic agent for neurodegenerative disorders such as Alzheimer’s and Parkinson’s disease.
4. Exploring its use in the development of vaccines for infectious diseases such as COVID-19.
5. Developing new biomaterials using D-Cellobiose octaacetate for tissue engineering and regenerative medicine.
6. Studying its potential in the treatment of chronic inflammatory diseases such as arthritis and asthma.
7. Improving our understanding of its immunomodulatory effects and their potential use in autoimmune disorders.
CAS Number | 3616-19-1 |
Product Name | D-Cellobiose octaacetate |
IUPAC Name | [(2R,3R,4S,5R,6S)-4,5,6-triacetyloxy-3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
Molecular Formula | C??H??O?? |
Molecular Weight | 678.6 g/mol |
InChI | InChI=1S/C28H38O19/c1-11(29)37-9-19-21(39-13(3)31)23(40-14(4)32)26(43-17(7)35)28(46-19)47-22-20(10-38-12(2)30)45-27(44-18(8)36)25(42-16(6)34)24(22)41-15(5)33/h19-28H,9-10H2,1-8H3/t19-,20-,21-,22-,23+,24+,25-,26-,27-,28+/m1/s1 |
InChI Key | WOTQVEKSRLZRSX-HYSGBLIFSA-N |
SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Synonyms | 4-O-(2,3,4,6-Tetra-O-acetyl-?-D-glucopyranosyl)-D-glucopyranose 1,2,3,6-Tetraacetate; Octa-O-acetylcellobiose; Octaacetyl-D-cellobiose; |
Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Isomeric SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
Size | 1 G, 100 MG, 5 G, Other |
---|
GalNAc-a1,3-(Fuc-a1,2)-Gal-b1,4-Glc, CAS:59957-92-5, G19524AS
10 in stock
10 in stock
10 in stock
10 in stock
Not a member? Create an account
Already got an account? Sign in here