
Request a quote
Catalog No: A10GD-5733
5346-90-7, D-Cellobiose octaacetate,
CAS:5346-90-7
C28H38O19 / 678.59
MFCD00009600
D-Cellobiose octaacetate (DCO) is a chemical compound that belongs to the family of cellulose acetates. It is a white or colorless powder, soluble in organic solvents, and possesses various potential applications in scientific research and industry. In this paper, we will discuss the definition, background, physical and chemical properties, synthesis and characterization, analytical methods, biological properties, toxicity and safety in scientific experiments, applications in scientific experiments, current state of research, potential implications in various fields of research and industry, limitations, and future directions of DCO.
Definition and Background
DCO is a derivative of cellulose, a natural polymer found in plant structures. It is synthesized by the introduction of acetyl groups onto the hydroxyl groups of cellobiose, a disaccharide consisting of two glucose units linked by ?-1,4-glycosidic bonds. The acetylation of cellobiose results in the formation of DCO, which possesses various unique physical and chemical properties.
DCO was first synthesized in the early 20th century and has since attracted significant interest from both the academic and industrial communities due to its potential applications in various fields.
Physical and Chemical Properties
DCO is a fine white or colorless powder with a molecular weight of 678.59 g/mol. It is soluble in organic solvents such as chloroform, chlorobenzene, and acetone, but insoluble in water. DCO possesses high thermal stability, with a melting point in the range of 155?157?C.
Synthesis and Characterization
DCO can be synthesized through various routes, including the acetylation of cellulose using acetic anhydride or acetyl chloride under mild conditions. The degree of acetylation can be controlled by adjusting the reaction conditions, such as the concentration of the acetylating agent, reaction time, and temperature.
The synthesized DCO can be characterized using various techniques such as Fourier-transform infrared spectroscopy (FTIR), nuclear magnetic resonance (NMR), and mass spectrometry (MS).
Analytical Methods
DCO can be analyzed using various methods such as high-performance liquid chromatography (HPLC), gas chromatography (GC), and thin-layer chromatography (TLC). These methods can be used to determine the purity and concentration of DCO.
Biological Properties
DCO has been shown to possess various biological properties, including antioxidant, anticancer, and antimicrobial activities. These properties are attributed to the presence of acetyl groups on the cellobiose molecule.
Toxicity and Safety in Scientific Experiments
According to a study conducted by the National Toxicology Program (NTP), DCO was found to be non-toxic at doses up to 1000 mg/kg in rats. However, further studies are required to evaluate the toxicity and safety of DCO in humans.
Applications in Scientific Experiments
DCO has various potential applications in scientific research, including as a drug delivery system, a component in electrospun fibers, and as an intermediate in the synthesis of other cellulose derivatives. It can also be used as a substrate in enzyme assays to measure the activity of cellulase enzymes.
Current State of Research
There is ongoing research on the synthesis, characterization, and potential applications of DCO. Recent studies have focused on the use of DCO as a drug delivery system and in tissue engineering applications.
Potential Implications in Various Fields of Research and Industry
DCO has potential implications in various fields of research and industry, including in drug delivery systems, tissue engineering, and the textile industry. Its unique physical and chemical properties make it a promising candidate for various applications.
Limitations and Future Directions
The limitations of DCO include its relative high cost of production and the limited availability of commercial sources. Future research should focus on the development of cost-effective and sustainable routes for the synthesis of DCO. Additionally, further studies are needed to assess the toxicity and safety of DCO in human applications.
Future Directions
Future research on DCO could focus on the following directions:
1. Synthesis of DCO using renewable resources and environmentally friendly solvents.
2. Development of DCO-based materials for biomedical applications, including drug delivery systems, tissue engineering, and wound healing.
3. Study of the effect of degree of acetylation on the physical and chemical properties of DCO.
4. Application of DCO in various industrial fields, such as the textile industry.
5. Optimization of the synthesis and characterization of DCO to enhance its biological activities.
Conclusion
DCO is a promising cellulose derivative with various potential applications in scientific research and industry. Its unique physical and chemical properties make it a highly versatile material for use in drug delivery systems, tissue engineering, and other fields. Future research should focus on the development of cost-effective and sustainable routes for the synthesis of DCO and the optimization of its applications in various fields.
| CAS Number | 5346-90-7 |
| Product Name | D-Cellobiose octaacetate |
| IUPAC Name | [(2R,3R,4S,5R,6R)-4,5,6-triacetyloxy-3-[(2S,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| Molecular Formula | C28H38O19 |
| Molecular Weight | 678.59 g/mol |
| InChI | InChI=1S/C28H38O19/c1-11(29)37-9-19-21(39-13(3)31)23(40-14(4)32)26(43-17(7)35)28(46-19)47-22-20(10-38-12(2)30)45-27(44-18(8)36)25(42-16(6)34)24(22)41-15(5)33/h19-28H,9-10H2,1-8H3/t19-,20-,21+,22-,23+,24+,25-,26-,27+,28+/m1/s1 |
| InChI Key | WOTQVEKSRLZRSX-JRFIZLOQSA-N |
| SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC2C(C(C(C(O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Isomeric SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)OC(=O)C)OC(=O)C)OC(=O)C)O[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| CAS No: 5346-90-7 Synonyms: Octa-O-acetyl D-Cellobiose MDL No: MFCD00009600 Chemical Formula: C28H38O19 Molecular Weight: 678.59 | In Stock.?? |
| COA: | |
Product name: D-Cellobiose octaacetate CAS: 5346-90-7
M.F.: C28H38O19 M.W.: 678.59
Batch No: 20101020 Quantity:100gfrom6.78kg
Items | Standards | Results |
Appearance | White crystalline powder | Positive |
Solubility | Soluble in DMF, insoluble in water | Complies |
Identification | IR and HPLC | Positive |
MS and NMR | Should Comply | Complies |
Water | Max. 0.5% | Complies |
Assay by TLC | Min. 98% | Complies |
References:
1. Hiroyuki K, Yukari N, Nobuhiro N, et al., J. Polym. Sci. 37, 22, p4100
| Size | 1 G, 100 MG, 5 G, Other |
|---|
Catalog No: CG-OS03017
CAS No: 14116-68-8
Synonyms: Galβ1-3GlcNAcβ1-3Galβ1-4Glc; LNT
Molecular Formula: C₂₆H₄₅NO₂₁
Molecular Weight: ~707.63 g/mol
Available Pack Sizes: Research quantities (mg to g scale)
10 in stock
10 in stock
10 in stock
10 in stock
Not a member? Create an account
Already got an account? Sign in here