D-Luciferin Firefly, potassium salt
(S)-4,5-Dihydro-2-(6-hydroxy-2-benzothiazolyl)-4-thiazolecarboxylic acid potassium salt
Chemiluminescent luciferase substrate. Water soluble derivative of D-Luciferin and analog of D-Luciferin sodium salt. Emits light on oxidative decarboxylation in the presence of ATP providing a bioluminescent signal for cellular ATP levels in vivo.
D-Luciferin is a chemiluminescent substrate of firefly luciferase. It produces light upon oxidative decarboxylation by luciferase in the presence of ATP. D-Luciferin can be employed to assay the expression of the luciferase gene linked to a promoter of interest. Alternatively, D-luciferin and luciferase can be used to assess ATP availability in cellular or biochemical assays.
D-Luciferin potassium is heterocyclic light-emitting compound and natural ligand for luciferase used to detect cell activity. It requires ATP for its reaction, emitting a greenish-yellow luminescence at a peak wavelength of approximately 530 nm. The salt form of luciferin dissolves in water or other typical buffers.
| CAS Number | 115144-35-9 |
| Product Name | Potassium (S)-2-(6-hydroxybenzo[d]thiazol-2-yl)-4,5-dihydrothiazole-4-carboxylate |
| IUPAC Name | potassium;(4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate |
| Molecular Formula | C11H7KN2O3S2 |
| Molecular Weight | 318.4 g/mol |
| InChI | InChI=1S/C11H8N2O3S2.K/c14-5-1-2-6-8(3-5)18-10(12-6)9-13-7(4-17-9)11(15)16;/h1-3,7,14H,4H2,(H,15,16);/q;+1/p-1/t7-;/m1./s1 |
| InChI Key | PWQWXGFOCJCDIF-SREJTOIWSA-M |
| SMILES | C1C(N=C(S1)C2=NC3=C(S2)C=C(C=C3)O)C(=O)[O-].[K+] |
| Solubility | Soluble in DMSO |
| Synonyms | D-Luciferin potassium |
| Canonical SMILES | C1C(NC(=C2N=C3C=CC(=O)C=C3S2)S1)C(=O)[O-].[K+] |
| Isomeric SMILES | C1[C@@H](N/C(=C/2N=C3C=CC(=O)C=C3S2)/S1)C(=O)[O-].[K+] |