DMNPE-cagedLuciferin,D-Luciferin1-(4,5-dimethoxy-2-nitrophenyl)ethylester

Request a quote

Catalog No: A10GD-4683
Cas No: 223920-67-0
Properties: Mol Formula: C21H19N3O7S2, Mol Weight: 489.5
IUPAC Name: 1-(4,5-dimethoxy-2-nitrophenyl)ethyl (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate
Synonym: D-Luciferin 1-(4,5-dimethoxy-2- nitrophenyl) ethyl ester, , 1-(4,5-DIMETHOXY-2-NITROPHENYL)ETHYL (4S)-2-(6-HYDROXY-1,3-BENZOTHIAZOL-2-YL)-4,5-DIHYDRO-1,3-THIAZOLE-4-CARBOXYLATE

+

  Share
Guaranteed Safe CheckoutTrust

DMNPE-caged Luciferin,D-Luciferin 1-(4,5-dimethoxy-2-nitrophenyl)ethyl ester

D-Luciferin 1-(4,5-dimethoxy-2- nitrophenyl) ethyl ester is a heterocyclic light-emitting compound and natural ligand for luciferase used to detect cell activity. It requires ATP for its reaction, emitting a greenish-yellow luminescence at a peak wavelenght of approximately 530 nm. DMNPE-caged lucifern crosses cell membranes easily.

D-Luciferin 1-(4,5-dimethoxy-2-nitrophenyl)ethyl ester is a chemiluminescent substrate specifically designed for luciferase enzymes. This nitrophenyl ester derivative of luciferin exhibits enhanced water solubility and improved stability compared to native D-luciferin. Upon enzymatic cleavage by luciferase, it generates a highly sensitive and stable luminescent signal, making it an ideal choice for various bioluminescence-based assays, including gene expression analysis, drug screening, and in vivo imaging. Its unique chemical structure allows for rapid and efficient cellular uptake, ensuring high sensitivity and low background noise in bioluminescent experiments.

CAS Number223920-67-0
Product NameD-Luciferin 1-(4,5-dimethoxy-2-nitrophenyl) ethyl ester
IUPAC Name1-(4,5-dimethoxy-2-nitrophenyl)ethyl (4S)-2-(6-hydroxy-1,3-benzothiazol-2-yl)-4,5-dihydro-1,3-thiazole-4-carboxylate
Molecular FormulaC21H19N3O7S2
Molecular Weight489.5 g/mol
InChIInChI=1S/C21H19N3O7S2/c1-10(12-7-16(29-2)17(30-3)8-15(12)24(27)28)31-21(26)14-9-32-19(23-14)20-22-13-5-4-11(25)6-18(13)33-20/h4-8,10,14,25H,9H2,1-3H3/t10?,14-/m1/s1
InChI KeyKQVRVPOUBLPROI-RMGLFMTASA-N
SMILESCC(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)OC(=O)C2CSC(=N2)C3=NC4=C(S3)C=C(C=C4)O
SolubilitySoluble in DMSO
SynonymsD-Luciferin 1-(4,5-dimethoxy-2- nitrophenyl) ethyl ester; DMNPE
Canonical SMILESCC(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)OC(=O)C2CSC(=N2)C3=NC4=C(S3)C=C(C=C4)O
Isomeric SMILESCC(C1=CC(=C(C=C1[N+](=O)[O-])OC)OC)OC(=O)[C@H]2CS/C(=C3/N=C4C=CC(=O)C=C4S3)/N2

2. MSDS

3. Tech Data Sheets/Manuals

Size

1 G, 100 MG, 5 G, Other

My Cart
Close Wishlist
Close Recently Viewed
Categories