1, 2, 3, 4, 5, 6-Hexa-O-acetyl-D-mannitol (1,2,3,4,5,6-HOM) is a glycoside that belongs to the group of pentose sugars. It is the only natural hexose sugar that contains an acetate residue in its structure. 1,2,3,4,5,6-HOM is found in plants and animals and has been shown to have anti-cancer properties. The reaction products of 1 with various enzymes are also studied for their cancer inhibitory effects. This molecule has also been shown to inhibit lipid peroxidation in mitochondria. 1,2,3,4,5,6-HOM binds to cell surface receptors on cancer cells and inhibits growth by inhibiting the synthesis of DNA and RNA.
| CAS Number | 642-00-2 |
| Product Name | Hexa-O-acetyl-D-mannitol |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5,6-pentaacetyloxyhexyl] acetate |
| Molecular Formula | C18H26O12 |
| Molecular Weight | 434.39 g/mol |
| InChI | InChI=1S/C18H26O12/c1-9(19)25-7-15(27-11(3)21)17(29-13(5)23)18(30-14(6)24)16(28-12(4)22)8-26-10(2)20/h15-18H,7-8H2,1-6H3/t15-,16-,17-,18-/m1/s1 |
| InChI Key | NJVBTKVPPOFGAT-BRSBDYLESA-N |
| SMILES | CC(=O)OCC(C(C(C(COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Synonyms | Hexa-O-acetyl-D-mannitol, Hexaacetyl mannitol |
| Canonical SMILES | CC(=O)OCC(C(C(C(COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Isomeric SMILES | CC(=O)OC[C@H]([C@H]([C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |