Hexyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside is a compound that is used in the research of cellular biology. It was found to have a significant effect on gene expression levels. This compound has been shown to be able to alter the expression profile of cells and may be useful for understanding how different genes affect cell function. The high density microarray provides a highly sensitive and accurate way to measure changes in gene expression levels.
| CAS Number | 172945-26-5 |
| Product Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-hexoxyoxan-2-yl]methyl acetate |
| IUPAC Name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-hexoxyoxan-2-yl]methyl acetate |
| Molecular Formula | C20H33NO9 |
| Molecular Weight | 431.48 g/mol |
| InChI | InChI=1S/C20H33NO9/c1-6-7-8-9-10-26-20-17(21-12(2)22)19(29-15(5)25)18(28-14(4)24)16(30-20)11-27-13(3)23/h16-20H,6-11H2,1-5H3,(H,21,22)/t16-,17-,18-,19-,20-/m1/s1 |
| InChI Key | RZSSLCQNNAGTQY-LASHMREHSA-N |
| SMILES | CCCCCCOC1C(C(C(C(O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
| Canonical SMILES | CCCCCCOC1C(C(C(C(O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
| Isomeric SMILES | CCCCCCO[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
| CAS No: 172945-26-5 MDL No: MFCD08703747 Chemical Formula: C20H33NO9 Molecular Weight: 431.48 |