LUM-NAG; 2-Aminophthalylhydrazido-N-acetyl-b-D-glucosaminide
(2-Aminophthalylhydrazido) 2-acetamido-2-deoxy-b-D-glucopyranoside
2-Aminophthalylhydrazido 2-acetamido-2-deoxy-b-D-glucopyranoside is a chromogenic substrate that is used as a diagnostic in biological research. It reacts with enzymes to form fluorescent products, and can be used to detect the presence of bacteria and fungi. This product has a CAS number of 128879-80-1 and can be used for food testing, environmental testing, or bioluminescence. It is an important component in the development of new antibiotics.
| CAS Number | 128879-80-1 |
| Product Name | Lum-nag |
| IUPAC Name | N-[(2S,3R,4R,5S,6R)-2-[(8-amino-4-oxo-3H-phthalazin-1-yl)oxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| Molecular Formula | C??H??N?O? |
| Molecular Weight | 380.35 g/mol |
| InChI | InChI=1S/C16H20N4O7/c1-6(22)18-11-13(24)12(23)9(5-21)26-16(11)27-15-10-7(14(25)19-20-15)3-2-4-8(10)17/h2-4,9,11-13,16,21,23-24H,5,17H2,1H3,(H,18,22)(H,19,25)/t9-,11-,12-,13-,16+/m1/s1 |
| InChI Key | WROZDOJWRUAYBA-CSTFGSAOSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1OC2=NNC(=O)C3=C2C(=CC=C3)N)CO)O)O |
| Synonyms | 3-aminophthalylhydrazido-N-acetyl-beta-glucosaminide, LUM-NAG |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=NNC(=O)C3=C2C(=CC=C3)N)CO)O)O |
| Isomeric SMILES | CC(=O)N[C@@H]1[C@H]([C@@H]([C@H](O[C@H]1OC2=NNC(=O)C3=C2C(=CC=C3)N)CO)O)O |