Resorufin methyl ether
7-Methoxy-3H-phenoxazin-3-one;
7-Methoxyresorufin;
Resorufin 7-O-methyl ether
Fluorogenic substrate used to differentiate cytochrome P450 monooxygenases.
Fluorometric competitive cytochrome P450 substrate. Resorufin butyrate analog. Shows selectivity for CYP1A (Ki = 20 ?M, dealkylation 0.5 ?M substrate).
Methoxyresorufin is a fluorogenic substrate for the cytochrome P450 (CYP) isoforms CYP1A1 and CYP1A2.1,2,3 Methyoxyresorufin is O-demethylated by CYP1A1/2, releasing resorufin, which displays excitation/emission maxima of 570/580 nm, respectively. The appearance of resorufin fluorescence can be used to quantify CYP1A1/2 activity.
| CAS Number | 5725-89-3 |
| Product Name | Methoxyresorufin |
| IUPAC Name | 7-methoxyphenoxazin-3-one |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 g/mol |
| InChI | InChI=1S/C13H9NO3/c1-16-9-3-5-11-13(7-9)17-12-6-8(15)2-4-10(12)14-11/h2-7H,1H3 |
| InChI Key | KNYYMGDYROYBRE-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |
| Synonyms | 7-Methoxy-3H-phenoxazin-3-one; 7-Methoxyphenoxazone; Methoxyresorufin; O-Methylresorufin; Resorufin Methyl Ether |
| Canonical SMILES | COC1=CC2=C(C=C1)N=C3C=CC(=O)C=C3O2 |