Naphthol AS-E phosphate
KG-501; N-(4-Chlorophenyl)-3-(phosphonooxy)-2-naphthalenecarboxamide
Naphthol AS-E phosphate is an inhibitor of the protein-protein interaction between CREB and the KIX domain of CREB-binding protein (CBP; Ki = 50 ?M). It also inhibits the binding of the transcription factor Myb to the KIX domains of p300 and CBP (IC50s = 30 and 43 ?M, respectively). Naphthol AS-E phosphate inhibits CREB-dependent transcription in HEK293T cells (Ki = 10 ?M). It also decreases the expression of Myb target genes and induces differentiation in HL-60, U937, and NB4 myeloid leukemia cells when used at a concentration of 5 ?M. Naphthol AS-E phosphate inhibits proliferation of NCI-H1734 lung adenocarcinoma cells (IC50 = 6.89 ?M).
KG-501 is a cAMP response element-binding protein (CREB) inhibitor.
CAS Number | 18228-17-6 |
Product Name | N-(4-Chlorophenyl)-3-(phosphonooxy)naphthalene-2-carboxamide |
IUPAC Name | [3-[(4-chlorophenyl)carbamoyl]naphthalen-2-yl] dihydrogen phosphate |
Molecular Formula | C17H13ClNO5P |
Molecular Weight | 377.7 g/mol |
InChI | InChI=1S/C17H13ClNO5P/c18-13-5-7-14(8-6-13)19-17(20)15-9-11-3-1-2-4-12(11)10-16(15)24-25(21,22)23/h1-10H,(H,19,20)(H2,21,22,23) |
InChI Key | RQAQWBFHPMSXKR-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=CC=C(C=C3)Cl)OP(=O)(O)O |
Solubility | Soluble in DMSO |
Synonyms | KG 501, KG-501, KG501 cpd, naphthol AS-E phosphate |
Canonical SMILES | C1=CC=C2C=C(C(=CC2=C1)C(=O)NC3=CC=C(C=C3)Cl)OP(=O)(O)O |