Naphthol AS-OL;C.I. 37530; 3-Hydroxy-2-naphtho-o-anisidine
Naphthol AS-OL is a widely used chromogenic enzyme substrate that forms a colored product upon reaction with specific enzymes. It is commonly employed in histochemical and cytochemical staining techniques to visualize enzyme activity in cells and tissues. Naphthol AS-OL is particularly useful for detecting the presence of enzymes such as alkaline phosphatase, acid phosphatase, and esterases. The resulting colored product can be easily observed under a microscope, allowing researchers to study the distribution and localization of these enzymes in various biological samples.
CAS Number |
135-62-6 |
Product Name |
Naphthol AS-OL |
IUPAC Name |
3-hydroxy-N-(2-methoxyphenyl)naphthalene-2-carboxamide |
Molecular Formula |
C18H15NO3 |
Molecular Weight |
293.3 g/mol |
InChI |
InChI=1S/C18H15NO3/c1-22-17-9-5-4-8-15(17)19-18(21)14-10-12-6-2-3-7-13(12)11-16(14)20/h2-11,20H,1H3,(H,19,21) |
InChI Key |
AQYMRQUYPFCXDM-UHFFFAOYSA-N |
SMILES |
COC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2O |
Solubility |
Soluble in DMSO |
Synonyms |
2-Naphthalenecarboxamide, 3-hydroxy-N-(2-methoxyphenyl)-; 3-Hydroxy-2′-methoxy-2-naphthanilide; 3-Hydroxy-N-(2-methoxyphenyl)-2-naphthalenecarboxamide; |
Canonical SMILES |
COC1=CC=CC=C1NC(=O)C2=CC3=CC=CC=C3C=C2O |