4-Nitrophenyl 5-O-trans-feruloyl-a-L-arabinofuranoside
4-Nitrophenyl 5-O-trans-feruloyl-a-L-arabinofuranoside is a high purity, enyzme substrate that is used in the diagnosis of phenylketonuria. It is also used to detect nitrophenols in environmental samples. This product has been shown to be a very good ligand for use in fluorescence and chemiluminescence studies. It can be used as a chromogenic substrate for the detection of enzymes such as oxidases and peroxidases. 4-Nitrophenyl 5-O-trans-feruloyl-a-L-arabinofuranoside has been shown to be a suitable bioluminescent substrate for the study of luciferase activity.
| CAS Number | 943833-83-8 |
| Product Name | p-Nitrophenyl-5-O-trans-feruloyl-alpha-L-arabinofuranoside |
| IUPAC Name | [(2S,3R,4R,5S)-3,4-dihydroxy-5-(4-nitrophenoxy)oxolan-2-yl]methyl (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Molecular Formula | C21H21NO10 |
| Molecular Weight | 447.4 g/mol |
| InChI | InChI=1S/C21H21NO10/c1-29-16-10-12(2-8-15(16)23)3-9-18(24)30-11-17-19(25)20(26)21(32-17)31-14-6-4-13(5-7-14)22(27)28/h2-10,17,19-21,23,25-26H,11H2,1H3/b9-3+/t17-,19-,20+,21+/m0/s1 |
| InChI Key | HWUYVLJKIQHEDV-LUIQYSJNSA-N |
| SMILES | COC1=C(C=CC(=C1)C=CC(=O)OCC2C(C(C(O2)OC3=CC=C(C=C3)[N+](=O)[O-])O)O)O |
| Canonical SMILES | COC1=C(C=CC(=C1)C=CC(=O)OCC2C(C(C(O2)OC3=CC=C(C=C3)[N+](=O)[O-])O)O)O |
| Isomeric SMILES | COC1=C(C=CC(=C1)/C=C/C(=O)OC[C@H]2[C@@H]([C@H]([C@@H](O2)OC3=CC=C(C=C3)[N+](=O)[O-])O)O)O |