Request a quote
Catalog No: A10GD-4573
Cas No: 4419-94-7
Properties: Mol Formula: C18H25NO13, Mol Weight: 463.4
IUPAC Name: (2S,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Synonym: 4-Nitrophenyl beta-D-lactopyranoside, 4-nitrophenyl beta-lactoside, P-NITROPHENYLBETA-D-LACTOPYRANOSIDE
4-nitrophenyl beta-lactoside is a disaccharide derivative that is beta-lactose in which the anomeric hydroxy hydrogen is replaced by a 4-nitrophenyl group. It has a role as a chromogenic compound. It is a glycoside, a C-nitro compound and a disaccharide derivative. It derives from a beta-lactose and a 4-nitrophenol.Chromogenic substrate for cellobiohydrolase and endoglucanase.
| CAS Number | 4419-94-7 |
| Product Name | P-Nitrophenyl beta-D-lactopyranoside |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-(4-nitrophenoxy)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C18H25NO13 |
| Molecular Weight | 463.4 g/mol |
| InChI | InChI=1S/C18H25NO13/c20-5-9-11(22)12(23)14(25)18(30-9)32-16-10(6-21)31-17(15(26)13(16)24)29-8-3-1-7(2-4-8)19(27)28/h1-4,9-18,20-26H,5-6H2/t9-,10-,11+,12+,13-,14-,15-,16-,17-,18+/m1/s1 |
| InChI Key | IAYJZWFYUSNIPN-MUKCROHVSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| Synonyms | Gal1-?-4Glc1-?-PNP |
| Canonical SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2C(C(C(C(O2)CO)OC3C(C(C(C(O3)CO)O)O)O)O)O |
| Isomeric SMILES | C1=CC(=CC=C1[N+](=O)[O-])O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O[C@H]3[C@@H]([C@H]([C@H]([C@H](O3)CO)O)O)O)O)O |
MDL No: MFCD00069843 Chemical Formula: C18H25NO13 Molecular Weight: 463.39 | In Stock.?? |
COA:
Name: 4-Nitrophenyl beta-D-lactopyranoside
CAS: 4419-94-7 M.F.: C18H25NO13 M.W.: 463.39
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| Size | 1 G, 100 MG, 5 G, Other |
|---|
10 in stock
10 in stock
10 in stock
IUPAC:Fuc(a1-2)[GalNAc(a1-3)]Gal(b1-3)GlcNAc(b1-3)Gal(b1-4)b-Glc, G82858KU
10 in stock
Glycodepot serve all your needs in glycoscience from products, services, networking and announcements. Get the best glycoscience products and services to support your research. Shop Now and learn about cutting-edge solutions in glycochemistry, glycobiology, and glyco-analysis!
